| General Information | |
|---|---|
| ZINC ID | ZINC000299867831 |
| Molecular Weight (Da) | 351 |
| SMILES | CCCCCn1cc2c(=O)n(CC3CCCCC3)nc-2c2ccccc21 |
| Molecular Formula | C22N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 106.22 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 5.697 |
| Activity (Ki) in nM | 0.617 |
| Polar Surface Area (PSA) | 39.82 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.0235182 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 13 |
| Fraction csp3 | 0.55 |
| Ilogp | 4.24 |
| Xlogp3 | 5.57 |
| Wlogp | 5.12 |
| Mlogp | 4.41 |
| Silicos-it log p | 4.51 |
| Consensus log p | 4.77 |
| Esol log s | -5.5 |
| Esol solubility (mg/ml) | 1.11E-03 |
| Esol solubility (mol/l) | 3.15E-06 |
| Esol class | Moderately |
| Ali log s | -6.17 |
| Ali solubility (mg/ml) | 2.39E-04 |
| Ali solubility (mol/l) | 6.80E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.28 |
| Silicos-it solubility (mg/ml) | 1.85E-04 |
| Silicos-it solubility (mol/l) | 5.27E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.49 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.98 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.964 |
| Logd | 4.626 |
| Logp | 5.899 |
| F (20%) | 0.299 |
| F (30%) | 0.008 |
| Mdck | 1.60E-05 |
| Ppb | 0.9675 |
| Vdss | 1.815 |
| Fu | 0.0139 |
| Cyp1a2-inh | 0.35 |
| Cyp1a2-sub | 0.491 |
| Cyp2c19-inh | 0.665 |
| Cyp2c19-sub | 0.107 |
| Cl | 8.078 |
| T12 | 0.02 |
| H-ht | 0.411 |
| Dili | 0.877 |
| Roa | 0.046 |
| Fdamdd | 0.308 |
| Skinsen | 0.529 |
| Ec | 0.004 |
| Ei | 0.149 |
| Respiratory | 0.896 |
| Bcf | 1.43 |
| Igc50 | 5.237 |
| Lc50 | 6.086 |
| Lc50dm | 5.649 |
| Nr-ar | 0.034 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.139 |
| Nr-aromatase | 0.924 |
| Nr-er | 0.323 |
| Nr-er-lbd | 0.046 |
| Nr-ppar-gamma | 0.043 |
| Sr-are | 0.743 |
| Sr-atad5 | 0.022 |
| Sr-hse | 0.669 |
| Sr-mmp | 0.646 |
| Sr-p53 | 0.752 |
| Vol | 380.804 |
| Dense | 0.922 |
| Flex | 22 |
| Nstereo | 0.273 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 3 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.581 |
| Fsp3 | 2.377 |
| Mce-18 | 0.545 |
| Natural product-likeness | 47.059 |
| Alarm nmr | -1.193 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |