| General Information | |
|---|---|
| ZINC ID | ZINC000299831163 |
| Molecular Weight (Da) | 394 |
| SMILES | CN1CC(S(=O)(=O)c2ccc3c(c2)nc(CC(C)(C)C)n3CC(C)(C)O)C1 |
| Molecular Formula | C20N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 106.513 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| LogP | 2.903 |
| Activity (Ki) in nM | 39.811 |
| Polar Surface Area (PSA) | 83.81 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.46080613 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.06 |
| Xlogp3 | 2.44 |
| Wlogp | 3.18 |
| Mlogp | 2.04 |
| Silicos-it log p | 2.32 |
| Consensus log p | 2.61 |
| Esol log s | -3.67 |
| Esol solubility (mg/ml) | 8.46E-02 |
| Esol solubility (mol/l) | 2.15E-04 |
| Esol class | Soluble |
| Ali log s | -3.84 |
| Ali solubility (mg/ml) | 5.65E-02 |
| Ali solubility (mol/l) | 1.43E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -4.53 |
| Silicos-it solubility (mg/ml) | 1.16E-02 |
| Silicos-it solubility (mol/l) | 2.96E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.97 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.879 |
| Logd | 1.906 |
| Logp | 2.342 |
| F (20%) | 0.01 |
| F (30%) | 0.002 |
| Mdck | 1.89E-05 |
| Ppb | 0.4871 |
| Vdss | 2.412 |
| Fu | 0.6737 |
| Cyp1a2-inh | 0.018 |
| Cyp1a2-sub | 0.102 |
| Cyp2c19-inh | 0.151 |
| Cyp2c19-sub | 0.924 |
| Cl | 6.798 |
| T12 | 0.228 |
| H-ht | 0.903 |
| Dili | 0.985 |
| Roa | 0.615 |
| Fdamdd | 0.884 |
| Skinsen | 0.039 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.423 |
| Bcf | 0.148 |
| Igc50 | 2.431 |
| Lc50 | 2.898 |
| Lc50dm | 3.442 |
| Nr-ar | 0.021 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.038 |
| Nr-aromatase | 0.006 |
| Nr-er | 0.095 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.078 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.005 |
| Sr-mmp | 0.044 |
| Sr-p53 | 0.006 |
| Vol | 396.131 |
| Dense | 0.993 |
| Flex | 16 |
| Nstereo | 0.375 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.845 |
| Fsp3 | 2.911 |
| Mce-18 | 0.65 |
| Natural product-likeness | 54.545 |
| Alarm nmr | -1.027 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Accepted |