| General Information | |
|---|---|
| ZINC ID | ZINC000299823678 |
| Molecular Weight (Da) | 313 |
| SMILES | CC(C)(CO)NC(=O)c1nn(-c2cnccn2)c2c1C[C@H]1C[C@@H]21 |
| Molecular Formula | C16N5O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 84.629 |
| HBA | 5 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| LogP | 0.457 |
| Activity (Ki) in nM | 25.119 |
| Polar Surface Area (PSA) | 92.93 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.33711397 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.5 |
| Ilogp | 2.82 |
| Xlogp3 | 0.14 |
| Wlogp | 0.82 |
| Mlogp | 0.47 |
| Silicos-it log p | 1.08 |
| Consensus log p | 1.07 |
| Esol log s | -1.89 |
| Esol solubility (mg/ml) | 3.99E+00 |
| Esol solubility (mol/l) | 1.27E-02 |
| Esol class | Very solub |
| Ali log s | -1.65 |
| Ali solubility (mg/ml) | 7.05E+00 |
| Ali solubility (mol/l) | 2.25E-02 |
| Ali class | Very solub |
| Silicos-it logsw | -3.46 |
| Silicos-it solubility (mg/ml) | 1.09E-01 |
| Silicos-it solubility (mol/l) | 3.48E-04 |
| Silicos-it class | Soluble |
| Pgp substrate | |
| Log kp (cm/s) | -8.11 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 4.16 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.071 |
| Logd | 1.789 |
| Logp | 1.382 |
| F (20%) | 0.002 |
| F (30%) | 0.005 |
| Mdck | 1.42E-05 |
| Ppb | 0.6914 |
| Vdss | 1.085 |
| Fu | 0.4197 |
| Cyp1a2-inh | 0.143 |
| Cyp1a2-sub | 0.291 |
| Cyp2c19-inh | 0.051 |
| Cyp2c19-sub | 0.812 |
| Cl | 5.22 |
| T12 | 0.665 |
| H-ht | 0.709 |
| Dili | 0.985 |
| Roa | 0.301 |
| Fdamdd | 0.802 |
| Skinsen | 0.849 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.63 |
| Bcf | 0.204 |
| Igc50 | 1.99 |
| Lc50 | 2.756 |
| Lc50dm | 2.387 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.817 |
| Nr-aromatase | 0.655 |
| Nr-er | 0.123 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.021 |
| Sr-are | 0.589 |
| Sr-atad5 | 0.018 |
| Sr-hse | 0.186 |
| Sr-mmp | 0.191 |
| Sr-p53 | 0.845 |
| Vol | 307.812 |
| Dense | 1.017 |
| Flex | 18 |
| Nstereo | 0.278 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.872 |
| Fsp3 | 3.739 |
| Mce-18 | 0.5 |
| Natural product-likeness | 76.667 |
| Alarm nmr | -1.062 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |