| General Information | |
|---|---|
| ZINC ID | ZINC000299822821 |
| Molecular Weight (Da) | 314 |
| SMILES | CCCCCc1cc(O)c2c(c1)OC1=C(CC[C@@H](C)C1)C2(C)C |
| Molecular Formula | C21O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 96.66 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| LogP | 6.28 |
| Activity (Ki) in nM | 467.735 |
| Polar Surface Area (PSA) | 29.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.11903655 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.99 |
| Xlogp3 | 6.45 |
| Wlogp | 5.87 |
| Mlogp | 4.39 |
| Silicos-it log p | 5.8 |
| Consensus log p | 5.3 |
| Esol log s | -5.78 |
| Esol solubility (mg/ml) | 0.000519 |
| Esol solubility (mol/l) | 0.00000165 |
| Esol class | Moderately |
| Ali log s | -6.86 |
| Ali solubility (mg/ml) | 0.0000431 |
| Ali solubility (mol/l) | 0.00000013 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.38 |
| Silicos-it solubility (mg/ml) | 0.000131 |
| Silicos-it solubility (mol/l) | 0.00000041 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.64 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.28 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.648 |
| Logd | 5.211 |
| Logp | 7.093 |
| F (20%) | 0.995 |
| F (30%) | 0.994 |
| Mdck | 1.39E-05 |
| Ppb | 0.9792 |
| Vdss | 2.661 |
| Fu | 0.0168 |
| Cyp1a2-inh | 0.782 |
| Cyp1a2-sub | 0.703 |
| Cyp2c19-inh | 0.911 |
| Cyp2c19-sub | 0.628 |
| Cl | 4.316 |
| T12 | 0.177 |
| H-ht | 0.024 |
| Dili | 0.182 |
| Roa | 0.151 |
| Fdamdd | 0.888 |
| Skinsen | 0.922 |
| Ec | 0.017 |
| Ei | 0.82 |
| Respiratory | 0.906 |
| Bcf | 2.795 |
| Igc50 | 5.051 |
| Lc50 | 5.826 |
| Lc50dm | 5.469 |
| Nr-ar | 0.513 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.258 |
| Nr-aromatase | 0.413 |
| Nr-er | 0.176 |
| Nr-er-lbd | 0.031 |
| Nr-ppar-gamma | 0.947 |
| Sr-are | 0.576 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.521 |
| Sr-mmp | 0.891 |
| Sr-p53 | 0.117 |
| Vol | 353.137 |
| Dense | 0.89 |
| Flex | 0.25 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.704 |
| Synth | 3.423 |
| Fsp3 | 0.619 |
| Mce-18 | 62.588 |
| Natural product-likeness | 1.146 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |