| General Information | |
|---|---|
| ZINC ID | ZINC000299821225 |
| Molecular Weight (Da) | 433 |
| SMILES | CC(C)(C)Cc1nc2cc(S(=O)(=O)C3CCN(C(N)=O)CC3)ccc2n1CC1CC1 |
| Molecular Formula | C22N4O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.305 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| LogP | 3.348 |
| Activity (Ki) in nM | 6.31 |
| Polar Surface Area (PSA) | 106.67 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.31423804 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.64 |
| Ilogp | 2.91 |
| Xlogp3 | 2.86 |
| Wlogp | 3.99 |
| Mlogp | 2.82 |
| Silicos-it log p | 2.11 |
| Consensus log p | 2.94 |
| Esol log s | -4.08 |
| Esol solubility (mg/ml) | 3.57E-02 |
| Esol solubility (mol/l) | 8.25E-05 |
| Esol class | Moderately |
| Ali log s | -4.76 |
| Ali solubility (mg/ml) | 7.53E-03 |
| Ali solubility (mol/l) | 1.74E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -4.61 |
| Silicos-it solubility (mg/ml) | 1.07E-02 |
| Silicos-it solubility (mol/l) | 2.48E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.91 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.6 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.102 |
| Logd | 2.8 |
| Logp | 3.196 |
| F (20%) | 0.001 |
| F (30%) | 0.004 |
| Mdck | 2.41E-05 |
| Ppb | 0.6718 |
| Vdss | 1.284 |
| Fu | 0.2799 |
| Cyp1a2-inh | 0.042 |
| Cyp1a2-sub | 0.107 |
| Cyp2c19-inh | 0.444 |
| Cyp2c19-sub | 0.348 |
| Cl | 3.045 |
| T12 | 0.11 |
| H-ht | 0.948 |
| Dili | 0.977 |
| Roa | 0.857 |
| Fdamdd | 0.951 |
| Skinsen | 0.027 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.113 |
| Bcf | 0.315 |
| Igc50 | 2.688 |
| Lc50 | 3.145 |
| Lc50dm | 3.68 |
| Nr-ar | 0.402 |
| Nr-ar-lbd | 0.045 |
| Nr-ahr | 0.087 |
| Nr-aromatase | 0.007 |
| Nr-er | 0.217 |
| Nr-er-lbd | 0.156 |
| Nr-ppar-gamma | 0.029 |
| Sr-are | 0.576 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.22 |
| Sr-mmp | 0.41 |
| Sr-p53 | 0.013 |
| Vol | 430.527 |
| Dense | 1.004 |
| Flex | 22 |
| Nstereo | 0.318 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.783 |
| Fsp3 | 2.774 |
| Mce-18 | 0.636 |
| Natural product-likeness | 66 |
| Alarm nmr | -1.549 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Rejected |