| General Information | |
|---|---|
| ZINC ID | ZINC000299820438 |
| Molecular Weight (Da) | 394 |
| SMILES | CC(C)(NC(=O)c1nn(-c2ccc(F)cc2F)c2c1C[C@H]1C[C@@H]21)c1cccnc1 |
| Molecular Formula | C22F2N4O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 105.225 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 3.599 |
| Activity (Ki) in nM | 1.514 |
| Polar Surface Area (PSA) | 59.81 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.93539476 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.32 |
| Ilogp | 3.5 |
| Xlogp3 | 3.23 |
| Wlogp | 4.6 |
| Mlogp | 3.58 |
| Silicos-it log p | 4.16 |
| Consensus log p | 3.82 |
| Esol log s | -4.42 |
| Esol solubility (mg/ml) | 0.0149 |
| Esol solubility (mol/l) | 0.0000377 |
| Esol class | Moderately |
| Ali log s | -4.16 |
| Ali solubility (mg/ml) | 0.0274 |
| Ali solubility (mol/l) | 0.0000693 |
| Ali class | Moderately |
| Silicos-it logsw | -7.02 |
| Silicos-it solubility (mg/ml) | 0.0000376 |
| Silicos-it solubility (mol/l) | 9.53E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.41 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.98 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.682 |
| Logd | 3.35 |
| Logp | 3.858 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 2.81E-05 |
| Ppb | 0.9316 |
| Vdss | 1.261 |
| Fu | 0.0566 |
| Cyp1a2-inh | 0.567 |
| Cyp1a2-sub | 0.71 |
| Cyp2c19-inh | 0.919 |
| Cyp2c19-sub | 0.841 |
| Cl | 1.988 |
| T12 | 0.136 |
| H-ht | 0.808 |
| Dili | 0.953 |
| Roa | 0.195 |
| Fdamdd | 0.942 |
| Skinsen | 0.331 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.888 |
| Bcf | 1.795 |
| Igc50 | 3.207 |
| Lc50 | 5.478 |
| Lc50dm | 6.343 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.861 |
| Nr-aromatase | 0.948 |
| Nr-er | 0.152 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.094 |
| Sr-are | 0.745 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.179 |
| Sr-mmp | 0.575 |
| Sr-p53 | 0.78 |
| Vol | 387.47 |
| Dense | 1.017 |
| Flex | 0.208 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.731 |
| Synth | 3.542 |
| Fsp3 | 0.318 |
| Mce-18 | 95 |
| Natural product-likeness | -1.314 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Accepted |