| General Information | |
|---|---|
| ZINC ID | ZINC000253638432 |
| Molecular Weight (Da) | 479 |
| SMILES | Cc1c(C(=O)N[C@@H]2CC[C@@H](O)CC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1 |
| Molecular Formula | C23Cl3N3O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.467 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 5.776 |
| Activity (Ki) in nM | 3467.369 |
| Polar Surface Area (PSA) | 67.15 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.052 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.24 |
| Xlogp3 | 5.88 |
| Wlogp | 5.84 |
| Mlogp | 4.34 |
| Silicos-it log p | 5.29 |
| Consensus log p | 5.12 |
| Esol log s | -6.59 |
| Esol solubility (mg/ml) | 0.000123 |
| Esol solubility (mol/l) | 0.00000025 |
| Esol class | Poorly sol |
| Ali log s | -7.06 |
| Ali solubility (mg/ml) | 0.0000414 |
| Ali solubility (mol/l) | 8.65E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.16 |
| Silicos-it solubility (mg/ml) | 0.00000334 |
| Silicos-it solubility (mol/l) | 6.98E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.05 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.99 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.981 |
| Logd | 3.897 |
| Logp | 5 |
| F (20%) | 0.001 |
| F (30%) | 0.793 |
| Mdck | 9.68E-06 |
| Ppb | 0.9846 |
| Vdss | 0.518 |
| Fu | 0.0161 |
| Cyp1a2-inh | 0.665 |
| Cyp1a2-sub | 0.502 |
| Cyp2c19-inh | 0.869 |
| Cyp2c19-sub | 0.272 |
| Cl | 2.253 |
| T12 | 0.042 |
| H-ht | 0.471 |
| Dili | 0.508 |
| Roa | 0.921 |
| Fdamdd | 0.928 |
| Skinsen | 0.035 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.184 |
| Bcf | 1.5 |
| Igc50 | 4.438 |
| Lc50 | 4.93 |
| Lc50dm | 5.808 |
| Nr-ar | 0.032 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.712 |
| Nr-aromatase | 0.885 |
| Nr-er | 0.398 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.652 |
| Sr-are | 0.761 |
| Sr-atad5 | 0.044 |
| Sr-hse | 0.609 |
| Sr-mmp | 0.903 |
| Sr-p53 | 0.891 |
| Vol | 444.614 |
| Dense | 1.073 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.495 |
| Synth | 2.429 |
| Fsp3 | 0.304 |
| Mce-18 | 57.6 |
| Natural product-likeness | -1.133 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |