| General Information | |
|---|---|
| ZINC ID | ZINC000205493818 |
| Molecular Weight (Da) | 377 |
| SMILES | CC(C)(C)c1cc(NC(=O)[C@@H]2CCCCN2C(=O)CC2CCOCC2)no1 |
| Molecular Formula | C20N3O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 99.816 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 2.514 |
| Activity (Ki) in nM | 6918.31 |
| Polar Surface Area (PSA) | 84.67 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.72391307 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 5 |
| Fraction csp3 | 0.75 |
| Ilogp | 3.41 |
| Xlogp3 | 2.53 |
| Wlogp | 2.54 |
| Mlogp | 1.31 |
| Silicos-it log p | 2.7 |
| Consensus log p | 2.5 |
| Esol log s | -3.45 |
| Esol solubility (mg/ml) | 0.134 |
| Esol solubility (mol/l) | 0.000355 |
| Esol class | Soluble |
| Ali log s | -3.95 |
| Ali solubility (mg/ml) | 0.0419 |
| Ali solubility (mol/l) | 0.000111 |
| Ali class | Soluble |
| Silicos-it logsw | -4.13 |
| Silicos-it solubility (mg/ml) | 0.0277 |
| Silicos-it solubility (mol/l) | 0.0000733 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.81 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.01 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.234 |
| Logd | 2.356 |
| Logp | 2.44 |
| F (20%) | 0.011 |
| F (30%) | 0.123 |
| Mdck | - |
| Ppb | 80.31% |
| Vdss | 0.649 |
| Fu | 18.03% |
| Cyp1a2-inh | 0.02 |
| Cyp1a2-sub | 0.413 |
| Cyp2c19-inh | 0.669 |
| Cyp2c19-sub | 0.288 |
| Cl | 5.469 |
| T12 | 0.627 |
| H-ht | 0.987 |
| Dili | 0.912 |
| Roa | 0.961 |
| Fdamdd | 0.803 |
| Skinsen | 0.159 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.708 |
| Bcf | 1.341 |
| Igc50 | 2.841 |
| Lc50 | 3.665 |
| Lc50dm | 4.472 |
| Nr-ar | 0.022 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.029 |
| Nr-aromatase | 0.086 |
| Nr-er | 0.259 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.075 |
| Sr-are | 0.607 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.072 |
| Sr-mmp | 0.35 |
| Sr-p53 | 0.02 |
| Vol | 386.412 |
| Dense | 0.976 |
| Flex | 0.3 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.877 |
| Synth | 3.755 |
| Fsp3 | 0.75 |
| Mce-18 | 67.857 |
| Natural product-likeness | -0.882 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |