| General Information | |
|---|---|
| ZINC ID | ZINC000169348775 |
| Molecular Weight (Da) | 496 |
| SMILES | Cc1ccc2c(c1)oc1c(C(=O)N[C@H]3C[C@H]4CC[C@]3(C)C4(C)C)nn(-c3ccc(Cl)cc3Cl)c12 |
| Molecular Formula | C27Cl2N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.133 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| LogP | 7.212 |
| Activity (Ki) in nM | 3.467 |
| Polar Surface Area (PSA) | 60.06 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03847348 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.41 |
| Ilogp | 4.88 |
| Xlogp3 | 7.92 |
| Wlogp | 7.33 |
| Mlogp | 5.5 |
| Silicos-it log p | 6.35 |
| Consensus log p | 6.4 |
| Esol log s | -8.04 |
| Esol solubility (mg/ml) | 0.00000458 |
| Esol solubility (mol/l) | 9.22E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.03 |
| Ali solubility (mg/ml) | 0.00000046 |
| Ali solubility (mol/l) | 9.31E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.55 |
| Silicos-it solubility (mg/ml) | 0.00000013 |
| Silicos-it solubility (mol/l) | 2.79E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.71 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -8.245 |
| Logd | 5.63 |
| Logp | 7.201 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | 9.30E-06 |
| Ppb | 0.9993 |
| Vdss | 1.336 |
| Fu | 0.0204 |
| Cyp1a2-inh | 0.175 |
| Cyp1a2-sub | 0.913 |
| Cyp2c19-inh | 0.858 |
| Cyp2c19-sub | 0.735 |
| Cl | 5.557 |
| T12 | 0.035 |
| H-ht | 0.951 |
| Dili | 0.974 |
| Roa | 0.575 |
| Fdamdd | 0.943 |
| Skinsen | 0.271 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.846 |
| Bcf | 2.115 |
| Igc50 | 5.294 |
| Lc50 | 6.412 |
| Lc50dm | 5.822 |
| Nr-ar | 0.023 |
| Nr-ar-lbd | 0.062 |
| Nr-ahr | 0.507 |
| Nr-aromatase | 0.819 |
| Nr-er | 0.541 |
| Nr-er-lbd | 0.116 |
| Nr-ppar-gamma | 0.919 |
| Sr-are | 0.862 |
| Sr-atad5 | 0.34 |
| Sr-hse | 0.308 |
| Sr-mmp | 0.866 |
| Sr-p53 | 0.867 |
| Vol | 481.474 |
| Dense | 1.028 |
| Flex | 0.138 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.323 |
| Synth | 4.452 |
| Fsp3 | 0.407 |
| Mce-18 | 124.632 |
| Natural product-likeness | -0.523 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |