| General Information | |
|---|---|
| ZINC ID | ZINC000147455175 |
| Molecular Weight (Da) | 395 |
| SMILES | CC(C)(C)c1cc(NC(=O)[C@@H]2CCC(=O)N2c2ccc(C(F)(F)F)cc2)on1 |
| Molecular Formula | C19F3N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 92.996 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 3.768 |
| Activity (Ki) in nM | 1.413 |
| Polar Surface Area (PSA) | 75.44 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.69765853 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.42 |
| Ilogp | 2.93 |
| Xlogp3 | 3.66 |
| Wlogp | 4.71 |
| Mlogp | 2.51 |
| Silicos-it log p | 3.45 |
| Consensus log p | 3.45 |
| Esol log s | -4.49 |
| Esol solubility (mg/ml) | 1.27E-02 |
| Esol solubility (mol/l) | 3.22E-05 |
| Esol class | Moderately |
| Ali log s | -4.93 |
| Ali solubility (mg/ml) | 4.61E-03 |
| Ali solubility (mol/l) | 1.17E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -5.88 |
| Silicos-it solubility (mg/ml) | 5.19E-04 |
| Silicos-it solubility (mol/l) | 1.31E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.11 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.55 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.58 |
| Logd | 3.383 |
| Logp | 3.312 |
| F (20%) | 0.001 |
| F (30%) | 0.007 |
| Mdck | 1.27E-05 |
| Ppb | 0.9669 |
| Vdss | 0.793 |
| Fu | 0.0181 |
| Cyp1a2-inh | 0.475 |
| Cyp1a2-sub | 0.9 |
| Cyp2c19-inh | 0.904 |
| Cyp2c19-sub | 0.824 |
| Cl | 1.296 |
| T12 | 0.274 |
| H-ht | 0.983 |
| Dili | 0.977 |
| Roa | 0.738 |
| Fdamdd | 0.734 |
| Skinsen | 0.108 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.972 |
| Bcf | 1.534 |
| Igc50 | 3.839 |
| Lc50 | 5.311 |
| Lc50dm | 5.898 |
| Nr-ar | 0.592 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.198 |
| Nr-aromatase | 0.066 |
| Nr-er | 0.767 |
| Nr-er-lbd | 0.043 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.869 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.012 |
| Sr-mmp | 0.57 |
| Sr-p53 | 0.581 |
| Vol | 370.619 |
| Dense | 1.066 |
| Flex | 19 |
| Nstereo | 0.263 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 2 |
| Qed | 1 |
| Synth | 0.845 |
| Fsp3 | 3.706 |
| Mce-18 | 0.421 |
| Natural product-likeness | 74.111 |
| Alarm nmr | -0.998 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Accepted |
| Goldentriangle | Accepted |