| General Information | |
|---|---|
| ZINC ID | ZINC000147432435 |
| Molecular Weight (Da) | 345 |
| SMILES | CC(C)(C)c1cc(NC(=O)[C@@H]2CCC(=O)N2c2ccc(F)cc2)on1 |
| Molecular Formula | C18F1N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 87.239 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 3.031 |
| Activity (Ki) in nM | 14.125 |
| Polar Surface Area (PSA) | 75.44 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.82184374 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.39 |
| Ilogp | 2.8 |
| Xlogp3 | 2.87 |
| Wlogp | 3.09 |
| Mlogp | 2.06 |
| Silicos-it log p | 2.79 |
| Consensus log p | 2.72 |
| Esol log s | -3.78 |
| Esol solubility (mg/ml) | 5.67E-02 |
| Esol solubility (mol/l) | 1.64E-04 |
| Esol class | Soluble |
| Ali log s | -4.11 |
| Ali solubility (mg/ml) | 2.66E-02 |
| Ali solubility (mol/l) | 7.70E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -5.31 |
| Silicos-it solubility (mg/ml) | 1.68E-03 |
| Silicos-it solubility (mol/l) | 4.86E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.37 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.602 |
| Logd | 2.5 |
| Logp | 2.513 |
| F (20%) | 0.001 |
| F (30%) | 0.007 |
| Mdck | 1.98E-05 |
| Ppb | 0.9244 |
| Vdss | 0.695 |
| Fu | 0.0469 |
| Cyp1a2-inh | 0.367 |
| Cyp1a2-sub | 0.877 |
| Cyp2c19-inh | 0.874 |
| Cyp2c19-sub | 0.739 |
| Cl | 1.656 |
| T12 | 0.45 |
| H-ht | 0.978 |
| Dili | 0.973 |
| Roa | 0.817 |
| Fdamdd | 0.869 |
| Skinsen | 0.222 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.949 |
| Bcf | 1.431 |
| Igc50 | 3.316 |
| Lc50 | 4.395 |
| Lc50dm | 5.697 |
| Nr-ar | 0.033 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.174 |
| Nr-aromatase | 0.023 |
| Nr-er | 0.372 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.778 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.286 |
| Sr-p53 | 0.188 |
| Vol | 341.188 |
| Dense | 1.012 |
| Flex | 19 |
| Nstereo | 0.211 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.909 |
| Fsp3 | 3.658 |
| Mce-18 | 0.389 |
| Natural product-likeness | 64.8 |
| Alarm nmr | -1.066 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Accepted |
| Goldentriangle | Accepted |