| General Information | |
|---|---|
| ZINC ID | ZINC000139719678 |
| Molecular Weight (Da) | 442 |
| SMILES | Cc1ccc2c(c1)oc1c(C(=O)NC3CCCCC3)nn(-c3ccc(Cl)cc3Cl)c12 |
| Molecular Formula | C23Cl2N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.094 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| LogP | 6.737 |
| Activity (Ki) in nM | 15.488 |
| Polar Surface Area (PSA) | 60.06 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08883369 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.42 |
| Xlogp3 | 6.76 |
| Wlogp | 6.45 |
| Mlogp | 4.7 |
| Silicos-it log p | 5.4 |
| Consensus log p | 5.54 |
| Esol log s | -7.02 |
| Esol solubility (mg/ml) | 0.0000421 |
| Esol solubility (mol/l) | 9.52E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.83 |
| Ali solubility (mg/ml) | 0.00000658 |
| Ali solubility (mol/l) | 1.49E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.43 |
| Silicos-it solubility (mg/ml) | 0.00000164 |
| Silicos-it solubility (mol/l) | 3.71E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.2 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.743 |
| Logd | 4.967 |
| Logp | 6.54 |
| F (20%) | 0.001 |
| F (30%) | 0.011 |
| Mdck | 9.81E-06 |
| Ppb | 0.9942 |
| Vdss | 1.402 |
| Fu | 0.0175 |
| Cyp1a2-inh | 0.408 |
| Cyp1a2-sub | 0.676 |
| Cyp2c19-inh | 0.869 |
| Cyp2c19-sub | 0.407 |
| Cl | 5.416 |
| T12 | 0.027 |
| H-ht | 0.949 |
| Dili | 0.975 |
| Roa | 0.887 |
| Fdamdd | 0.729 |
| Skinsen | 0.181 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.84 |
| Bcf | 1.5 |
| Igc50 | 5.042 |
| Lc50 | 5.688 |
| Lc50dm | 5.284 |
| Nr-ar | 0.052 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.919 |
| Nr-aromatase | 0.856 |
| Nr-er | 0.553 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.89 |
| Sr-are | 0.888 |
| Sr-atad5 | 0.659 |
| Sr-hse | 0.371 |
| Sr-mmp | 0.883 |
| Sr-p53 | 0.915 |
| Vol | 420.847 |
| Dense | 1.048 |
| Flex | 0.148 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.397 |
| Synth | 2.513 |
| Fsp3 | 0.304 |
| Mce-18 | 64.8 |
| Natural product-likeness | -1.256 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |