| General Information | |
|---|---|
| ZINC ID | ZINC000103268377 |
| Molecular Weight (Da) | 335 |
| SMILES | CCn1c(C(=O)NCC(C)(C)C)nc2c(-c3ccccc3)cccc21 |
| Molecular Formula | C21N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 99.662 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| LogP | 4.454 |
| Activity (Ki) in nM | 489.779 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.9326328 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.33 |
| Ilogp | 3.79 |
| Xlogp3 | 4.7 |
| Wlogp | 4.5 |
| Mlogp | 3.34 |
| Silicos-it log p | 4.17 |
| Consensus log p | 4.1 |
| Esol log s | -4.93 |
| Esol solubility (mg/ml) | 0.00395 |
| Esol solubility (mol/l) | 0.0000118 |
| Esol class | Moderately |
| Ali log s | -5.41 |
| Ali solubility (mg/ml) | 0.00129 |
| Ali solubility (mol/l) | 0.00000386 |
| Ali class | Moderately |
| Silicos-it logsw | -6.98 |
| Silicos-it solubility (mg/ml) | 0.0000351 |
| Silicos-it solubility (mol/l) | 0.0000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.01 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.88 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.006 |
| Logd | 4.366 |
| Logp | 5.235 |
| F (20%) | 0.697 |
| F (30%) | 0.105 |
| Mdck | 1.50E-05 |
| Ppb | 0.9738 |
| Vdss | 0.837 |
| Fu | 0.0159 |
| Cyp1a2-inh | 0.952 |
| Cyp1a2-sub | 0.314 |
| Cyp2c19-inh | 0.963 |
| Cyp2c19-sub | 0.073 |
| Cl | 5.796 |
| T12 | 0.101 |
| H-ht | 0.701 |
| Dili | 0.236 |
| Roa | 0.203 |
| Fdamdd | 0.897 |
| Skinsen | 0.071 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.692 |
| Bcf | 1.494 |
| Igc50 | 4.462 |
| Lc50 | 5.522 |
| Lc50dm | 6.038 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.866 |
| Nr-aromatase | 0.141 |
| Nr-er | 0.288 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.849 |
| Sr-are | 0.675 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.622 |
| Sr-mmp | 0.646 |
| Sr-p53 | 0.839 |
| Vol | 366.792 |
| Dense | 0.914 |
| Flex | 0.353 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.763 |
| Synth | 2.329 |
| Fsp3 | 0.333 |
| Mce-18 | 19 |
| Natural product-likeness | -1.031 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |