| General Information | |
|---|---|
| ZINC ID | ZINC000103266718 |
| Molecular Weight (Da) | 450 |
| SMILES | O=C(NC1CCCCCC1)c1cccn(Cc2ccc(I)cc2)c1=O |
| Molecular Formula | C20I1N2O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 106.897 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 4.555 |
| Activity (Ki) in nM | 186.209 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.04961717 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.4 |
| Ilogp | 3.81 |
| Xlogp3 | 4.37 |
| Wlogp | 3.95 |
| Mlogp | 3.77 |
| Silicos-it log p | 4.4 |
| Consensus log p | 4.06 |
| Esol log s | -5.41 |
| Esol solubility (mg/ml) | 0.00175 |
| Esol solubility (mol/l) | 0.00000389 |
| Esol class | Moderately |
| Ali log s | -5.16 |
| Ali solubility (mg/ml) | 0.00312 |
| Ali solubility (mol/l) | 0.00000693 |
| Ali class | Moderately |
| Silicos-it logsw | -6.57 |
| Silicos-it solubility (mg/ml) | 0.000121 |
| Silicos-it solubility (mol/l) | 0.00000027 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.94 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.75 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.553 |
| Logd | 3.299 |
| Logp | 4.542 |
| F (20%) | 0.905 |
| F (30%) | 0.962 |
| Mdck | 2.14E-05 |
| Ppb | 0.9629 |
| Vdss | 1.011 |
| Fu | 0.0188 |
| Cyp1a2-inh | 0.56 |
| Cyp1a2-sub | 0.139 |
| Cyp2c19-inh | 0.831 |
| Cyp2c19-sub | 0.126 |
| Cl | 2.805 |
| T12 | 0.044 |
| H-ht | 0.389 |
| Dili | 0.507 |
| Roa | 0.362 |
| Fdamdd | 0.372 |
| Skinsen | 0.64 |
| Ec | 0.003 |
| Ei | 0.024 |
| Respiratory | 0.056 |
| Bcf | 0.943 |
| Igc50 | 4.706 |
| Lc50 | 5.221 |
| Lc50dm | 5.38 |
| Nr-ar | 0.043 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.099 |
| Nr-aromatase | 0.919 |
| Nr-er | 0.248 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.869 |
| Sr-are | 0.387 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.733 |
| Sr-mmp | 0.798 |
| Sr-p53 | 0.339 |
| Vol | 375.202 |
| Dense | 1.2 |
| Flex | 0.238 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.567 |
| Synth | 2.118 |
| Fsp3 | 0.4 |
| Mce-18 | 40 |
| Natural product-likeness | -1.565 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |