| General Information | |
|---|---|
| ZINC ID | ZINC000103263603 |
| Molecular Weight (Da) | 419 |
| SMILES | O=C(NC1CCCCCC1)c1cc(-c2ccccc2)cn(Cc2ccc(F)cc2)c1=O |
| Molecular Formula | C26F1N2O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.841 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 5.7 |
| Activity (Ki) in nM | 1.202 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.214 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.31 |
| Ilogp | 4.27 |
| Xlogp3 | 5 |
| Wlogp | 5.58 |
| Mlogp | 4.49 |
| Silicos-it log p | 5.43 |
| Consensus log p | 4.95 |
| Esol log s | -5.62 |
| Esol solubility (mg/ml) | 0.00101 |
| Esol solubility (mol/l) | 0.00000241 |
| Esol class | Moderately |
| Ali log s | -5.81 |
| Ali solubility (mg/ml) | 0.000644 |
| Ali solubility (mol/l) | 0.00000154 |
| Ali class | Moderately |
| Silicos-it logsw | -8.45 |
| Silicos-it solubility (mg/ml) | 0.0000015 |
| Silicos-it solubility (mol/l) | 3.58E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.3 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.27 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.423 |
| Logd | 4.245 |
| Logp | 5.432 |
| F (20%) | 0.734 |
| F (30%) | 0.958 |
| Mdck | 1.81E-05 |
| Ppb | 0.9798 |
| Vdss | 2.606 |
| Fu | 0.0069 |
| Cyp1a2-inh | 0.328 |
| Cyp1a2-sub | 0.121 |
| Cyp2c19-inh | 0.647 |
| Cyp2c19-sub | 0.061 |
| Cl | 4.45 |
| T12 | 0.018 |
| H-ht | 0.678 |
| Dili | 0.588 |
| Roa | 0.348 |
| Fdamdd | 0.641 |
| Skinsen | 0.259 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.146 |
| Bcf | 1.231 |
| Igc50 | 4.964 |
| Lc50 | 5.591 |
| Lc50dm | 6.465 |
| Nr-ar | 0.018 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.458 |
| Nr-aromatase | 0.917 |
| Nr-er | 0.333 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.905 |
| Sr-are | 0.534 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.664 |
| Sr-mmp | 0.798 |
| Sr-p53 | 0.149 |
| Vol | 443.303 |
| Dense | 0.943 |
| Flex | 0.222 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.582 |
| Synth | 2.117 |
| Fsp3 | 0.308 |
| Mce-18 | 50.647 |
| Natural product-likeness | -1.252 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |