| General Information | |
|---|---|
| ZINC ID | ZINC000103211881 |
| Molecular Weight (Da) | 397 |
| SMILES | COC(=O)Cn1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1 |
| Molecular Formula | C17Cl3N3O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 98.367 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| LogP | 5.424 |
| Activity (Ki) in nM | 851.138 |
| Polar Surface Area (PSA) | 57.01 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.02553308 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.12 |
| Ilogp | 3.45 |
| Xlogp3 | 5.47 |
| Wlogp | 4.75 |
| Mlogp | 3.06 |
| Silicos-it log p | 4.66 |
| Consensus log p | 4.28 |
| Esol log s | -5.92 |
| Esol solubility (mg/ml) | 0.000478 |
| Esol solubility (mol/l) | 0.00000121 |
| Esol class | Moderately |
| Ali log s | -6.42 |
| Ali solubility (mg/ml) | 0.000149 |
| Ali solubility (mol/l) | 0.00000037 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.33 |
| Silicos-it solubility (mg/ml) | 0.0000187 |
| Silicos-it solubility (mol/l) | 4.72E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.84 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.17 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.034 |
| Logd | 3.909 |
| Logp | 4.845 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 99.39% |
| Vdss | 0.47 |
| Fu | 1.59% |
| Cyp1a2-inh | 0.973 |
| Cyp1a2-sub | 0.488 |
| Cyp2c19-inh | 0.959 |
| Cyp2c19-sub | 0.095 |
| Cl | 11.157 |
| T12 | 0.021 |
| H-ht | 0.12 |
| Dili | 0.987 |
| Roa | 0.228 |
| Fdamdd | 0.131 |
| Skinsen | 0.045 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.021 |
| Bcf | 2.988 |
| Igc50 | 4.777 |
| Lc50 | 6.456 |
| Lc50dm | 5.508 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.066 |
| Nr-ahr | 0.33 |
| Nr-aromatase | 0.283 |
| Nr-er | 0.428 |
| Nr-er-lbd | 0.025 |
| Nr-ppar-gamma | 0.205 |
| Sr-are | 0.814 |
| Sr-atad5 | 0.495 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.354 |
| Sr-p53 | 0.841 |
| Vol | 349.395 |
| Dense | 1.131 |
| Flex | 0.278 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.597 |
| Synth | 2.309 |
| Fsp3 | 0.118 |
| Mce-18 | 18 |
| Natural product-likeness | -1.15 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |