| General Information | |
|---|---|
| ZINC ID | ZINC000101667688 |
| Molecular Weight (Da) | 267 |
| SMILES | O=C(N1CCc2ccccc21)C12C[C@@H]3CC1C[C@H](C3)C2 |
| Molecular Formula | C18N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 78.415 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| LogP | 3.458 |
| Activity (Ki) in nM | 21.878 |
| Polar Surface Area (PSA) | 20.31 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.8235678 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.61 |
| Ilogp | 4.25 |
| Xlogp3 | 6.25 |
| Wlogp | 3.02 |
| Mlogp | 3.28 |
| Silicos-it log p | 5.5 |
| Consensus log p | 4.99 |
| Esol log s | -5.67 |
| Esol solubility (mg/ml) | 8.21E-04 |
| Esol solubility (mol/l) | 2.12E-06 |
| Esol class | Moderately |
| Ali log s | -7.2 |
| Ali solubility (mg/ml) | 2.42E-05 |
| Ali solubility (mol/l) | 6.25E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.18 |
| Silicos-it solubility (mg/ml) | 2.58E-05 |
| Silicos-it solubility (mol/l) | 6.67E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.22 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.94 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.499 |
| Logd | 3.97 |
| Logp | 4.415 |
| F (20%) | 0.013 |
| F (30%) | 0.028 |
| Mdck | 2.31E-05 |
| Ppb | 0.6625 |
| Vdss | 1.157 |
| Fu | 0.1983 |
| Cyp1a2-inh | 0.348 |
| Cyp1a2-sub | 0.766 |
| Cyp2c19-inh | 0.803 |
| Cyp2c19-sub | 0.901 |
| Cl | 3.744 |
| T12 | 0.083 |
| H-ht | 0.667 |
| Dili | 0.042 |
| Roa | 0.201 |
| Fdamdd | 0.9 |
| Skinsen | 0.694 |
| Ec | 0.003 |
| Ei | 0.024 |
| Respiratory | 0.698 |
| Bcf | 2.732 |
| Igc50 | 3.162 |
| Lc50 | 3.592 |
| Lc50dm | 4.752 |
| Nr-ar | 0.377 |
| Nr-ar-lbd | 0.058 |
| Nr-ahr | 0.843 |
| Nr-aromatase | 0.327 |
| Nr-er | 0.888 |
| Nr-er-lbd | 0.569 |
| Nr-ppar-gamma | 0.516 |
| Sr-are | 0.514 |
| Sr-atad5 | 0.031 |
| Sr-hse | 0.404 |
| Sr-mmp | 0.432 |
| Sr-p53 | 0.628 |
| Vol | 286.343 |
| Dense | 0.933 |
| Flex | 22 |
| Nstereo | 0.091 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.763 |
| Fsp3 | 4.365 |
| Mce-18 | 0.611 |
| Natural product-likeness | 93.966 |
| Alarm nmr | -0.354 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |