| General Information | |
|---|---|
| ZINC ID | ZINC000096938375 |
| Molecular Weight (Da) | 414 |
| SMILES | CS(=O)(=O)NCCCn1c2ccccc2c2cc(C(=O)N3CCCCC3)ccc21 |
| Molecular Formula | C22N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.747 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 2.816 |
| Activity (Ki) in nM | 7.244 |
| Polar Surface Area (PSA) | 79.79 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.80962622 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 13 |
| Fraction csp3 | 0.41 |
| Ilogp | 2.61 |
| Xlogp3 | 3.04 |
| Wlogp | 4.06 |
| Mlogp | 2.21 |
| Silicos-it log p | 2.62 |
| Consensus log p | 2.91 |
| Esol log s | -4.19 |
| Esol solubility (mg/ml) | 0.0268 |
| Esol solubility (mol/l) | 0.0000647 |
| Esol class | Moderately |
| Ali log s | -4.38 |
| Ali solubility (mg/ml) | 0.0172 |
| Ali solubility (mol/l) | 0.0000416 |
| Ali class | Moderately |
| Silicos-it logsw | -6.29 |
| Silicos-it solubility (mg/ml) | 0.00021 |
| Silicos-it solubility (mol/l) | 0.0000005 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.66 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.335 |
| Logd | 2.676 |
| Logp | 3.013 |
| F (20%) | 0.341 |
| F (30%) | 0.027 |
| Mdck | 2.46E-05 |
| Ppb | 0.8694 |
| Vdss | 1.869 |
| Fu | 0.1275 |
| Cyp1a2-inh | 0.856 |
| Cyp1a2-sub | 0.589 |
| Cyp2c19-inh | 0.683 |
| Cyp2c19-sub | 0.128 |
| Cl | 4.48 |
| T12 | 0.062 |
| H-ht | 0.949 |
| Dili | 0.877 |
| Roa | 0.308 |
| Fdamdd | 0.911 |
| Skinsen | 0.143 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.518 |
| Bcf | 0.888 |
| Igc50 | 4.198 |
| Lc50 | 4.894 |
| Lc50dm | 4.778 |
| Nr-ar | 0.021 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.771 |
| Nr-aromatase | 0.022 |
| Nr-er | 0.113 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.577 |
| Sr-atad5 | 0.018 |
| Sr-hse | 0.019 |
| Sr-mmp | 0.134 |
| Sr-p53 | 0.105 |
| Vol | 414.257 |
| Dense | 0.997 |
| Flex | 0.292 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.63 |
| Synth | 2.189 |
| Fsp3 | 0.409 |
| Mce-18 | 53.419 |
| Natural product-likeness | -1.452 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |