| General Information | |
|---|---|
| ZINC ID | ZINC000096937556 |
| Molecular Weight (Da) | 537 |
| SMILES | CC(C)CCC(=O)NC1CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| Molecular Formula | C28Cl2N6O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 148.46 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| LogP | 6.362 |
| Activity (Ki) in nM | 213.796 |
| Polar Surface Area (PSA) | 75.94 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.927 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.36 |
| Ilogp | 4.82 |
| Xlogp3 | 6.58 |
| Wlogp | 5.93 |
| Mlogp | 4.82 |
| Silicos-it log p | 5.3 |
| Consensus log p | 5.49 |
| Esol log s | -7.21 |
| Esol solubility (mg/ml) | 0.0000332 |
| Esol solubility (mol/l) | 6.17E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.97 |
| Ali solubility (mg/ml) | 0.00000571 |
| Ali solubility (mol/l) | 1.06E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.51 |
| Silicos-it solubility (mg/ml) | 0.00000016 |
| Silicos-it solubility (mol/l) | 3.08E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.91 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.906 |
| Logd | 4.709 |
| Logp | 5.635 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | 2.37E-05 |
| Ppb | 0.9684 |
| Vdss | 2.074 |
| Fu | 0.0254 |
| Cyp1a2-inh | 0.421 |
| Cyp1a2-sub | 0.29 |
| Cyp2c19-inh | 0.9 |
| Cyp2c19-sub | 0.165 |
| Cl | 4.183 |
| T12 | 0.107 |
| H-ht | 0.868 |
| Dili | 0.958 |
| Roa | 0.932 |
| Fdamdd | 0.924 |
| Skinsen | 0.125 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.547 |
| Bcf | 1.864 |
| Igc50 | 4.591 |
| Lc50 | 5.395 |
| Lc50dm | 5.195 |
| Nr-ar | 0.052 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.85 |
| Nr-aromatase | 0.906 |
| Nr-er | 0.656 |
| Nr-er-lbd | 0.146 |
| Nr-ppar-gamma | 0.852 |
| Sr-are | 0.883 |
| Sr-atad5 | 0.597 |
| Sr-hse | 0.534 |
| Sr-mmp | 0.683 |
| Sr-p53 | 0.9 |
| Vol | 526.254 |
| Dense | 1.019 |
| Flex | 0.276 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.299 |
| Synth | 2.604 |
| Fsp3 | 0.357 |
| Mce-18 | 63.368 |
| Natural product-likeness | -1.463 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |