| General Information | |
|---|---|
| ZINC ID | ZINC000096915012 |
| Molecular Weight (Da) | 475 |
| SMILES | Cc1ccc(Cn2cc(C(=O)N[C@@H]3C(C)(C)[C@@H]4CC[C@@]3(C)C4)cc2-c2ccc(Cl)c(C)c2)cc1 |
| Molecular Formula | C30Cl1N2O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 138.484 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| LogP | 7.609 |
| Activity (Ki) in nM | 15.136 |
| Polar Surface Area (PSA) | 34.03 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.24429106 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.43 |
| Ilogp | 5.14 |
| Xlogp3 | 7.52 |
| Wlogp | 7.42 |
| Mlogp | 5.52 |
| Silicos-it log p | 7.37 |
| Consensus log p | 6.59 |
| Esol log s | -7.5 |
| Esol solubility (mg/ml) | 1.51E-05 |
| Esol solubility (mol/l) | 3.18E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.07 |
| Ali solubility (mg/ml) | 4.05E-06 |
| Ali solubility (mol/l) | 8.52E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.08 |
| Silicos-it solubility (mg/ml) | 3.97E-08 |
| Silicos-it solubility (mol/l) | 8.36E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.86 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.325 |
| Logd | 5.354 |
| Logp | 7.791 |
| F (20%) | 0.012 |
| F (30%) | 0.887 |
| Mdck | 1.01E-05 |
| Ppb | 0.9984 |
| Vdss | 1.704 |
| Fu | 0.01 |
| Cyp1a2-inh | 0.149 |
| Cyp1a2-sub | 0.662 |
| Cyp2c19-inh | 0.723 |
| Cyp2c19-sub | 0.121 |
| Cl | 4.895 |
| T12 | 0.044 |
| H-ht | 0.409 |
| Dili | 0.354 |
| Roa | 0.313 |
| Fdamdd | 0.952 |
| Skinsen | 0.136 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.78 |
| Bcf | 3.377 |
| Igc50 | 5.321 |
| Lc50 | 6.292 |
| Lc50dm | 6.895 |
| Nr-ar | 0.02 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.015 |
| Nr-aromatase | 0.896 |
| Nr-er | 0.568 |
| Nr-er-lbd | 0.2 |
| Nr-ppar-gamma | 0.071 |
| Sr-are | 0.684 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.091 |
| Sr-mmp | 0.83 |
| Sr-p53 | 0.259 |
| Vol | 506.92 |
| Dense | 0.936 |
| Flex | 26 |
| Nstereo | 0.231 |
| Nongenotoxic carcinogenicity | 3 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.41 |
| Fsp3 | 4.333 |
| Mce-18 | 0.433 |
| Natural product-likeness | 106.419 |
| Alarm nmr | -0.289 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |