| General Information | |
|---|---|
| ZINC ID | ZINC000096908240 |
| Molecular Weight (Da) | 397 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)n2nc(C)cc12 |
| Molecular Formula | C23N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.28 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 3.622 |
| Activity (Ki) in nM | 12.589 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.92149066 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.7 |
| Ilogp | 3.21 |
| Xlogp3 | 4.8 |
| Wlogp | 3.69 |
| Mlogp | 3.91 |
| Silicos-it log p | 3.26 |
| Consensus log p | 3.77 |
| Esol log s | -5.09 |
| Esol solubility (mg/ml) | 0.00322 |
| Esol solubility (mol/l) | 0.00000813 |
| Esol class | Moderately |
| Ali log s | -5.97 |
| Ali solubility (mg/ml) | 0.000426 |
| Ali solubility (mol/l) | 0.00000108 |
| Ali class | Moderately |
| Silicos-it logsw | -5.18 |
| Silicos-it solubility (mg/ml) | 0.00262 |
| Silicos-it solubility (mol/l) | 0.00000661 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.31 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.57 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.089 |
| Logd | 4.133 |
| Logp | 4.048 |
| F (20%) | 0.002 |
| F (30%) | 0.075 |
| Mdck | 3.40E-05 |
| Ppb | 0.7153 |
| Vdss | 1.124 |
| Fu | 0.1582 |
| Cyp1a2-inh | 0.183 |
| Cyp1a2-sub | 0.347 |
| Cyp2c19-inh | 0.808 |
| Cyp2c19-sub | 0.139 |
| Cl | 8.583 |
| T12 | 0.1 |
| H-ht | 0.473 |
| Dili | 0.169 |
| Roa | 0.007 |
| Fdamdd | 0.44 |
| Skinsen | 0.031 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.423 |
| Bcf | 0.964 |
| Igc50 | 3.832 |
| Lc50 | 4.696 |
| Lc50dm | 5.671 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.1 |
| Nr-aromatase | 0.007 |
| Nr-er | 0.184 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.591 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.6 |
| Sr-mmp | 0.245 |
| Sr-p53 | 0.131 |
| Vol | 411.967 |
| Dense | 0.962 |
| Flex | 0.292 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.757 |
| Synth | 4.018 |
| Fsp3 | 0.696 |
| Mce-18 | 70.359 |
| Natural product-likeness | -1.185 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |