| General Information | |
|---|---|
| ZINC ID | ZINC000096908237 |
| Molecular Weight (Da) | 527 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)n2nc(-c3ccc(Cl)cc3Cl)cc12 |
| Molecular Formula | C28Cl2N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 142.754 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| LogP | 6.615 |
| Activity (Ki) in nM | 30.2 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.04072928 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.54 |
| Ilogp | 4.66 |
| Xlogp3 | 7.32 |
| Wlogp | 6.36 |
| Mlogp | 5.63 |
| Silicos-it log p | 5.61 |
| Consensus log p | 5.92 |
| Esol log s | -7.5 |
| Esol solubility (mg/ml) | 1.66E-05 |
| Esol solubility (mol/l) | 3.15E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.58 |
| Ali solubility (mg/ml) | 1.38E-06 |
| Ali solubility (mol/l) | 2.61E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.41 |
| Silicos-it solubility (mg/ml) | 2.07E-06 |
| Silicos-it solubility (mol/l) | 3.93E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.32 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 6.05 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.159 |
| Logd | 5.355 |
| Logp | 6.624 |
| F (20%) | 0.002 |
| F (30%) | 0.015 |
| Mdck | 2.22E-05 |
| Ppb | 0.9857 |
| Vdss | 1.163 |
| Fu | 0.0136 |
| Cyp1a2-inh | 0.162 |
| Cyp1a2-sub | 0.164 |
| Cyp2c19-inh | 0.755 |
| Cyp2c19-sub | 0.076 |
| Cl | 7.166 |
| T12 | 0.008 |
| H-ht | 0.581 |
| Dili | 0.485 |
| Roa | 0.043 |
| Fdamdd | 0.786 |
| Skinsen | 0.034 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.516 |
| Bcf | 2.926 |
| Igc50 | 5.17 |
| Lc50 | 6.123 |
| Lc50dm | 6.537 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.781 |
| Nr-aromatase | 0.65 |
| Nr-er | 0.294 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.024 |
| Sr-are | 0.848 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.873 |
| Sr-mmp | 0.885 |
| Sr-p53 | 0.887 |
| Vol | 512.403 |
| Dense | 1.027 |
| Flex | 30 |
| Nstereo | 0.267 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.364 |
| Fsp3 | 4.055 |
| Mce-18 | 0.536 |
| Natural product-likeness | 83.814 |
| Alarm nmr | -1.235 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |