| General Information | |
|---|---|
| ZINC ID | ZINC000096908235 |
| Molecular Weight (Da) | 475 |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCC2)c(=O)n2nc(-c3ccc(Cl)cc3Cl)cc12 |
| Molecular Formula | C24Cl2N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.152 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 6.33 |
| Activity (Ki) in nM | 52.481 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.1067686 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.46 |
| Ilogp | 3.74 |
| Xlogp3 | 6.45 |
| Wlogp | 5.72 |
| Mlogp | 4.84 |
| Silicos-it log p | 5.07 |
| Consensus log p | 5.17 |
| Esol log s | -6.67 |
| Esol solubility (mg/ml) | 1.02E-04 |
| Esol solubility (mol/l) | 2.14E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.68 |
| Ali solubility (mg/ml) | 9.92E-06 |
| Ali solubility (mol/l) | 2.09E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.84 |
| Silicos-it solubility (mg/ml) | 6.94E-06 |
| Silicos-it solubility (mol/l) | 1.46E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.62 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.025 |
| Logd | 4.288 |
| Logp | 6.124 |
| F (20%) | 0.008 |
| F (30%) | 0.014 |
| Mdck | 1.61E-05 |
| Ppb | 0.9797 |
| Vdss | 1.642 |
| Fu | 0.0232 |
| Cyp1a2-inh | 0.354 |
| Cyp1a2-sub | 0.192 |
| Cyp2c19-inh | 0.745 |
| Cyp2c19-sub | 0.105 |
| Cl | 7.972 |
| T12 | 0.028 |
| H-ht | 0.603 |
| Dili | 0.849 |
| Roa | 0.074 |
| Fdamdd | 0.905 |
| Skinsen | 0.172 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.112 |
| Bcf | 1.611 |
| Igc50 | 5.061 |
| Lc50 | 5.035 |
| Lc50dm | 5.898 |
| Nr-ar | 0.015 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.482 |
| Nr-aromatase | 0.884 |
| Nr-er | 0.451 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.569 |
| Sr-are | 0.871 |
| Sr-atad5 | 0.05 |
| Sr-hse | 0.568 |
| Sr-mmp | 0.884 |
| Sr-p53 | 0.854 |
| Vol | 460.332 |
| Dense | 1.03 |
| Flex | 24 |
| Nstereo | 0.333 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0 |
| Synth | 0.445 |
| Fsp3 | 2.67 |
| Mce-18 | 0.458 |
| Natural product-likeness | 53.886 |
| Alarm nmr | -1.371 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |