| General Information | |
|---|---|
| ZINC ID | ZINC000096905687 |
| Molecular Weight (Da) | 435 |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCCC2)c(=O)n2nc(-c3ccccc3C)cc12 |
| Molecular Formula | C26N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.185 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 5.944 |
| Activity (Ki) in nM | 8.913 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.16125941 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.61 |
| Xlogp3 | 6.1 |
| Wlogp | 5.11 |
| Mlogp | 4.31 |
| Silicos-it log p | 4.55 |
| Consensus log p | 4.74 |
| Esol log s | -6.2 |
| Esol solubility (mg/ml) | 2.77E-04 |
| Esol solubility (mol/l) | 6.36E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.32 |
| Ali solubility (mg/ml) | 2.09E-05 |
| Ali solubility (mol/l) | 4.81E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.31 |
| Silicos-it solubility (mg/ml) | 2.12E-05 |
| Silicos-it solubility (mol/l) | 4.88E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.62 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.8 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.656 |
| Logd | 4.656 |
| Logp | 5.923 |
| F (20%) | 0.095 |
| F (30%) | 0.291 |
| Mdck | 2.13E-05 |
| Ppb | 0.955 |
| Vdss | 1.655 |
| Fu | 0.0171 |
| Cyp1a2-inh | 0.253 |
| Cyp1a2-sub | 0.338 |
| Cyp2c19-inh | 0.701 |
| Cyp2c19-sub | 0.152 |
| Cl | 8.359 |
| T12 | 0.049 |
| H-ht | 0.478 |
| Dili | 0.613 |
| Roa | 0.033 |
| Fdamdd | 0.851 |
| Skinsen | 0.327 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.195 |
| Bcf | 1.049 |
| Igc50 | 4.951 |
| Lc50 | 4.685 |
| Lc50dm | 5.508 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.177 |
| Nr-aromatase | 0.881 |
| Nr-er | 0.494 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.477 |
| Sr-are | 0.787 |
| Sr-atad5 | 0.043 |
| Sr-hse | 0.49 |
| Sr-mmp | 0.762 |
| Sr-p53 | 0.598 |
| Vol | 464.502 |
| Dense | 0.935 |
| Flex | 25 |
| Nstereo | 0.32 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.415 |
| Fsp3 | 2.602 |
| Mce-18 | 0.5 |
| Natural product-likeness | 51.897 |
| Alarm nmr | -1.164 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |