| General Information | |
|---|---|
| ZINC ID | ZINC000095597511 |
| Molecular Weight (Da) | 358 |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCC2)c(=O)c2c(C)nn(C)c21 |
| Molecular Formula | C20N4O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.366 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 3.535 |
| Activity (Ki) in nM | 85.114 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.92060798 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.79 |
| Xlogp3 | 3.83 |
| Wlogp | 3.3 |
| Mlogp | 2.44 |
| Silicos-it log p | 3.26 |
| Consensus log p | 3.32 |
| Esol log s | -4.27 |
| Esol solubility (mg/ml) | 0.0193 |
| Esol solubility (mol/l) | 0.0000538 |
| Esol class | Moderately |
| Ali log s | -4.97 |
| Ali solubility (mg/ml) | 0.00382 |
| Ali solubility (mol/l) | 0.0000106 |
| Ali class | Moderately |
| Silicos-it logsw | -4.97 |
| Silicos-it solubility (mg/ml) | 0.00386 |
| Silicos-it solubility (mol/l) | 0.0000108 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.77 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.22 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.823 |
| Logd | 3.145 |
| Logp | 3.613 |
| F (20%) | 0.01 |
| F (30%) | 0.02 |
| Mdck | 2.49E-05 |
| Ppb | 0.8828 |
| Vdss | 1.793 |
| Fu | 0.0904 |
| Cyp1a2-inh | 0.571 |
| Cyp1a2-sub | 0.862 |
| Cyp2c19-inh | 0.634 |
| Cyp2c19-sub | 0.59 |
| Cl | 5.529 |
| T12 | 0.051 |
| H-ht | 0.336 |
| Dili | 0.337 |
| Roa | 0.065 |
| Fdamdd | 0.471 |
| Skinsen | 0.081 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.355 |
| Bcf | 0.699 |
| Igc50 | 3.752 |
| Lc50 | 3.615 |
| Lc50dm | 4.456 |
| Nr-ar | 0.021 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.214 |
| Nr-aromatase | 0.648 |
| Nr-er | 0.175 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.339 |
| Sr-are | 0.664 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.196 |
| Sr-mmp | 0.302 |
| Sr-p53 | 0.281 |
| Vol | 377.192 |
| Dense | 0.95 |
| Flex | 0.389 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.806 |
| Synth | 2.567 |
| Fsp3 | 0.65 |
| Mce-18 | 42.545 |
| Natural product-likeness | -1.261 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |