| General Information | |
|---|---|
| ZINC ID | ZINC000095597012 |
| Molecular Weight (Da) | 383 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)n2ncnc12 |
| Molecular Formula | C21N5O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 108.394 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 2.796 |
| Activity (Ki) in nM | 707.946 |
| Polar Surface Area (PSA) | 81.81 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.75328147 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.71 |
| Ilogp | 2.93 |
| Xlogp3 | 4.17 |
| Wlogp | 2.78 |
| Mlogp | 3.49 |
| Silicos-it log p | 2.16 |
| Consensus log p | 3.11 |
| Esol log s | -4.62 |
| Esol solubility (mg/ml) | 0.00919 |
| Esol solubility (mol/l) | 0.000024 |
| Esol class | Moderately |
| Ali log s | -5.59 |
| Ali solubility (mg/ml) | 0.000996 |
| Ali solubility (mol/l) | 0.0000026 |
| Ali class | Moderately |
| Silicos-it logsw | -4.43 |
| Silicos-it solubility (mg/ml) | 0.0142 |
| Silicos-it solubility (mol/l) | 0.0000371 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.68 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.48 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.748 |
| Logd | 3.782 |
| Logp | 3.71 |
| F (20%) | 0.001 |
| F (30%) | 0.013 |
| Mdck | - |
| Ppb | 69.64% |
| Vdss | 0.914 |
| Fu | 25.94% |
| Cyp1a2-inh | 0.186 |
| Cyp1a2-sub | 0.149 |
| Cyp2c19-inh | 0.755 |
| Cyp2c19-sub | 0.064 |
| Cl | 7.055 |
| T12 | 0.596 |
| H-ht | 0.81 |
| Dili | 0.24 |
| Roa | 0.017 |
| Fdamdd | 0.226 |
| Skinsen | 0.023 |
| Ec | 0.003 |
| Ei | 0.028 |
| Respiratory | 0.686 |
| Bcf | 0.723 |
| Igc50 | 3.445 |
| Lc50 | 4.53 |
| Lc50dm | 5.474 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.253 |
| Nr-aromatase | 0.013 |
| Nr-er | 0.166 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.529 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.19 |
| Sr-mmp | 0.277 |
| Sr-p53 | 0.034 |
| Vol | 388.372 |
| Dense | 0.987 |
| Flex | 0.292 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.778 |
| Synth | 4.04 |
| Fsp3 | 0.714 |
| Mce-18 | 69 |
| Natural product-likeness | -1.239 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |