| General Information | |
|---|---|
| ZINC ID | ZINC000095596514 |
| Molecular Weight (Da) | 425 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)c2c(CC)nn(C)c21 |
| Molecular Formula | C25N4O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.492 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| LogP | 4.486 |
| Activity (Ki) in nM | 37.154 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.86072355 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.72 |
| Ilogp | 3.74 |
| Xlogp3 | 5.13 |
| Wlogp | 4.19 |
| Mlogp | 3.52 |
| Silicos-it log p | 4.23 |
| Consensus log p | 4.16 |
| Esol log s | -5.39 |
| Esol solubility (mg/ml) | 0.00173 |
| Esol solubility (mol/l) | 0.00000406 |
| Esol class | Moderately |
| Ali log s | -6.32 |
| Ali solubility (mg/ml) | 0.000202 |
| Ali solubility (mol/l) | 0.00000047 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.95 |
| Silicos-it solubility (mg/ml) | 0.00048 |
| Silicos-it solubility (mol/l) | 0.00000113 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.25 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.82 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.135 |
| Logd | 4.245 |
| Logp | 4.599 |
| F (20%) | 0.002 |
| F (30%) | 0.005 |
| Mdck | 2.67E-05 |
| Ppb | 0.9304 |
| Vdss | 1.772 |
| Fu | 0.0213 |
| Cyp1a2-inh | 0.242 |
| Cyp1a2-sub | 0.585 |
| Cyp2c19-inh | 0.811 |
| Cyp2c19-sub | 0.166 |
| Cl | 3.882 |
| T12 | 0.016 |
| H-ht | 0.371 |
| Dili | 0.186 |
| Roa | 0.089 |
| Fdamdd | 0.768 |
| Skinsen | 0.024 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.644 |
| Bcf | 1.428 |
| Igc50 | 4.104 |
| Lc50 | 5.052 |
| Lc50dm | 5.798 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.086 |
| Nr-aromatase | 0.009 |
| Nr-er | 0.207 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.053 |
| Sr-are | 0.749 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.636 |
| Sr-mmp | 0.346 |
| Sr-p53 | 0.293 |
| Vol | 446.559 |
| Dense | 0.95 |
| Flex | 0.333 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.678 |
| Synth | 4.094 |
| Fsp3 | 0.72 |
| Mce-18 | 71.488 |
| Natural product-likeness | -0.973 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |