| General Information | |
|---|---|
| ZINC ID | ZINC000095594231 |
| Molecular Weight (Da) | 373 |
| SMILES | CCCCCCn1cc(C(=O)NC2CCCCC2)c(=O)c2c(C)nn(C)c21 |
| Molecular Formula | C21N4O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 107.967 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| LogP | 3.991 |
| Activity (Ki) in nM | 3235.94 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.738 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.67 |
| Ilogp | 3.46 |
| Xlogp3 | 4.37 |
| Wlogp | 3.69 |
| Mlogp | 2.66 |
| Silicos-it log p | 3.66 |
| Consensus log p | 3.57 |
| Esol log s | -4.62 |
| Esol solubility (mg/ml) | 0.00891 |
| Esol solubility (mol/l) | 0.0000239 |
| Esol class | Moderately |
| Ali log s | -5.53 |
| Ali solubility (mg/ml) | 0.00109 |
| Ali solubility (mol/l) | 0.00000293 |
| Ali class | Moderately |
| Silicos-it logsw | -5.36 |
| Silicos-it solubility (mg/ml) | 0.00162 |
| Silicos-it solubility (mol/l) | 0.00000435 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.47 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.864 |
| Logd | 3.385 |
| Logp | 3.962 |
| F (20%) | 0.049 |
| F (30%) | 0.082 |
| Mdck | - |
| Ppb | 90.60% |
| Vdss | 1.717 |
| Fu | 7.86% |
| Cyp1a2-inh | 0.482 |
| Cyp1a2-sub | 0.841 |
| Cyp2c19-inh | 0.652 |
| Cyp2c19-sub | 0.551 |
| Cl | 5.426 |
| T12 | 0.042 |
| H-ht | 0.319 |
| Dili | 0.375 |
| Roa | 0.062 |
| Fdamdd | 0.492 |
| Skinsen | 0.098 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.44 |
| Bcf | 0.771 |
| Igc50 | 4.132 |
| Lc50 | 3.96 |
| Lc50dm | 4.569 |
| Nr-ar | 0.022 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.239 |
| Nr-aromatase | 0.815 |
| Nr-er | 0.197 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.446 |
| Sr-are | 0.693 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.229 |
| Sr-mmp | 0.375 |
| Sr-p53 | 0.356 |
| Vol | 394.488 |
| Dense | 0.944 |
| Flex | 0.444 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.754 |
| Synth | 2.571 |
| Fsp3 | 0.667 |
| Mce-18 | 42.171 |
| Natural product-likeness | -1.175 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |