| General Information | |
|---|---|
| ZINC ID | ZINC000095592792 |
| Molecular Weight (Da) | 485 |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| Molecular Formula | C30N2O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 146.295 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| LogP | 6.492 |
| Activity (Ki) in nM | 165.959 |
| Polar Surface Area (PSA) | 49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.05510151 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.2 |
| Ilogp | 4.1 |
| Xlogp3 | 6.54 |
| Wlogp | 7.37 |
| Mlogp | 4.95 |
| Silicos-it log p | 5.36 |
| Consensus log p | 5.67 |
| Esol log s | -6.81 |
| Esol solubility (mg/ml) | 7.46E-05 |
| Esol solubility (mol/l) | 1.54E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.37 |
| Ali solubility (mg/ml) | 2.08E-05 |
| Ali solubility (mol/l) | 4.30E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.78 |
| Silicos-it solubility (mg/ml) | 8.08E-09 |
| Silicos-it solubility (mol/l) | 1.67E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.61 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.428 |
| Logd | 5.152 |
| Logp | 6.542 |
| F (20%) | 0.995 |
| F (30%) | 0.497 |
| Mdck | 1.41E-05 |
| Ppb | 1.0069 |
| Vdss | 0.415 |
| Fu | 0.0066 |
| Cyp1a2-inh | 0.458 |
| Cyp1a2-sub | 0.478 |
| Cyp2c19-inh | 0.79 |
| Cyp2c19-sub | 0.059 |
| Cl | 9.656 |
| T12 | 0.031 |
| H-ht | 0.242 |
| Dili | 0.987 |
| Roa | 0.332 |
| Fdamdd | 0.206 |
| Skinsen | 0.036 |
| Ec | 0.003 |
| Ei | 0.521 |
| Respiratory | 0.18 |
| Bcf | 2.42 |
| Igc50 | 5.364 |
| Lc50 | 6.431 |
| Lc50dm | 6.911 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.04 |
| Nr-ahr | 0.296 |
| Nr-aromatase | 0.981 |
| Nr-er | 0.8 |
| Nr-er-lbd | 0.433 |
| Nr-ppar-gamma | 0.32 |
| Sr-are | 0.886 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.765 |
| Sr-mmp | 0.926 |
| Sr-p53 | 0.408 |
| Vol | 519.656 |
| Dense | 0.932 |
| Flex | 26 |
| Nstereo | 0.385 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.255 |
| Fsp3 | 2.085 |
| Mce-18 | 0.2 |
| Natural product-likeness | 23 |
| Alarm nmr | -1.187 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |