| General Information | |
|---|---|
| ZINC ID | ZINC000095589766 |
| Molecular Weight (Da) | 494 |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccc(N(CC)CC)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| Molecular Formula | C29N3O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 150.125 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| LogP | 6.32 |
| Activity (Ki) in nM | 537.032 |
| Polar Surface Area (PSA) | 52.24 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.90649294 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.14 |
| Xlogp3 | 6.14 |
| Wlogp | 6.86 |
| Mlogp | 4.41 |
| Silicos-it log p | 4.84 |
| Consensus log p | 5.28 |
| Esol log s | -6.36 |
| Esol solubility (mg/ml) | 2.17E-04 |
| Esol solubility (mol/l) | 4.39E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.02 |
| Ali solubility (mg/ml) | 4.72E-05 |
| Ali solubility (mol/l) | 9.56E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.56 |
| Silicos-it solubility (mg/ml) | 1.36E-07 |
| Silicos-it solubility (mol/l) | 2.76E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.95 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 4 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.65 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.708 |
| Logd | 4.974 |
| Logp | 6.511 |
| F (20%) | 0.011 |
| F (30%) | 0.242 |
| Mdck | 1.27E-05 |
| Ppb | 0.9983 |
| Vdss | 0.679 |
| Fu | 0.0068 |
| Cyp1a2-inh | 0.415 |
| Cyp1a2-sub | 0.914 |
| Cyp2c19-inh | 0.878 |
| Cyp2c19-sub | 0.102 |
| Cl | 11.71 |
| T12 | 0.051 |
| H-ht | 0.339 |
| Dili | 0.985 |
| Roa | 0.307 |
| Fdamdd | 0.231 |
| Skinsen | 0.068 |
| Ec | 0.003 |
| Ei | 0.41 |
| Respiratory | 0.776 |
| Bcf | 1.76 |
| Igc50 | 5.229 |
| Lc50 | 6.406 |
| Lc50dm | 7.11 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.582 |
| Nr-aromatase | 0.992 |
| Nr-er | 0.681 |
| Nr-er-lbd | 0.247 |
| Nr-ppar-gamma | 0.022 |
| Sr-are | 0.884 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.823 |
| Sr-mmp | 0.912 |
| Sr-p53 | 0.655 |
| Vol | 529.822 |
| Dense | 0.931 |
| Flex | 20 |
| Nstereo | 0.6 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.307 |
| Fsp3 | 2.273 |
| Mce-18 | 0.379 |
| Natural product-likeness | 21 |
| Alarm nmr | -1.195 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |