| General Information | |
|---|---|
| ZINC ID | ZINC000095588577 |
| Molecular Weight (Da) | 310 |
| SMILES | CN1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| Molecular Formula | C20N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 92.241 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| LogP | 3.693 |
| Activity (Ki) in nM | 21.878 |
| Polar Surface Area (PSA) | 23.55 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.84735524 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.25 |
| Xlogp3 | 3.76 |
| Wlogp | 2.92 |
| Mlogp | 3.7 |
| Silicos-it log p | 2.87 |
| Consensus log p | 3.3 |
| Esol log s | -4.19 |
| Esol solubility (mg/ml) | 1.98E-02 |
| Esol solubility (mol/l) | 6.39E-05 |
| Esol class | Moderately |
| Ali log s | -3.95 |
| Ali solubility (mg/ml) | 3.50E-02 |
| Ali solubility (mol/l) | 1.13E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -4.01 |
| Silicos-it solubility (mg/ml) | 3.05E-02 |
| Silicos-it solubility (mol/l) | 9.84E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.52 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.71 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.081 |
| Logd | 3.868 |
| Logp | 4.456 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | 2.50E-05 |
| Ppb | 0.8404 |
| Vdss | 1.371 |
| Fu | 0.0613 |
| Cyp1a2-inh | 0.162 |
| Cyp1a2-sub | 0.792 |
| Cyp2c19-inh | 0.721 |
| Cyp2c19-sub | 0.915 |
| Cl | 3.231 |
| T12 | 0.036 |
| H-ht | 0.528 |
| Dili | 0.11 |
| Roa | 0.892 |
| Fdamdd | 0.084 |
| Skinsen | 0.077 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.542 |
| Bcf | 3.241 |
| Igc50 | 3.685 |
| Lc50 | 4.668 |
| Lc50dm | 5.693 |
| Nr-ar | 0.292 |
| Nr-ar-lbd | 0.012 |
| Nr-ahr | 0.782 |
| Nr-aromatase | 0.521 |
| Nr-er | 0.35 |
| Nr-er-lbd | 0.035 |
| Nr-ppar-gamma | 0.031 |
| Sr-are | 0.749 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.337 |
| Sr-mmp | 0.71 |
| Sr-p53 | 0.866 |
| Vol | 331.932 |
| Dense | 0.935 |
| Flex | 24 |
| Nstereo | 0.083 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.79 |
| Fsp3 | 3.623 |
| Mce-18 | 0.65 |
| Natural product-likeness | 70.909 |
| Alarm nmr | -0.636 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |