| General Information | |
|---|---|
| ZINC ID | ZINC000095588201 |
| Molecular Weight (Da) | 295 |
| SMILES | Cc1cccc2c1N(C(=O)C13CC4CC(CC(C4)C1)C3)CC2 |
| Molecular Formula | C20N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 88.057 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| LogP | 4.4 |
| Activity (Ki) in nM | 50.119 |
| Polar Surface Area (PSA) | 20.31 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.96727168 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.1 |
| Xlogp3 | 4.26 |
| Wlogp | 3.72 |
| Mlogp | 4.31 |
| Silicos-it log p | 4.17 |
| Consensus log p | 3.91 |
| Esol log s | -4.43 |
| Esol solubility (mg/ml) | 1.11E-02 |
| Esol solubility (mol/l) | 3.76E-05 |
| Esol class | Moderately |
| Ali log s | -4.4 |
| Ali solubility (mg/ml) | 1.18E-02 |
| Ali solubility (mol/l) | 4.00E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -4.68 |
| Silicos-it solubility (mg/ml) | 6.20E-03 |
| Silicos-it solubility (mol/l) | 2.10E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.08 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.44 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.378 |
| Logd | 4.243 |
| Logp | 5.201 |
| F (20%) | 0.002 |
| F (30%) | 0.006 |
| Mdck | 2.51E-05 |
| Ppb | 0.8645 |
| Vdss | 1.453 |
| Fu | 0.0294 |
| Cyp1a2-inh | 0.121 |
| Cyp1a2-sub | 0.819 |
| Cyp2c19-inh | 0.704 |
| Cyp2c19-sub | 0.872 |
| Cl | 2.527 |
| T12 | 0.036 |
| H-ht | 0.419 |
| Dili | 0.059 |
| Roa | 0.186 |
| Fdamdd | 0.059 |
| Skinsen | 0.038 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.239 |
| Bcf | 3.384 |
| Igc50 | 3.704 |
| Lc50 | 4.654 |
| Lc50dm | 5.65 |
| Nr-ar | 0.08 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.394 |
| Nr-aromatase | 0.587 |
| Nr-er | 0.27 |
| Nr-er-lbd | 0.115 |
| Nr-ppar-gamma | 0.083 |
| Sr-are | 0.613 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.151 |
| Sr-mmp | 0.556 |
| Sr-p53 | 0.176 |
| Vol | 320.935 |
| Dense | 0.92 |
| Flex | 23 |
| Nstereo | 0.087 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.764 |
| Fsp3 | 3.634 |
| Mce-18 | 0.65 |
| Natural product-likeness | 70.909 |
| Alarm nmr | -0.757 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |