| General Information | |
|---|---|
| ZINC ID | ZINC000095587377 |
| Molecular Weight (Da) | 409 |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| Molecular Formula | C24N2O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.159 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| LogP | 4.974 |
| Activity (Ki) in nM | 169.824 |
| Polar Surface Area (PSA) | 49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.92780131 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.48 |
| Xlogp3 | 4.91 |
| Wlogp | 5.7 |
| Mlogp | 3.96 |
| Silicos-it log p | 3.75 |
| Consensus log p | 4.36 |
| Esol log s | -5.33 |
| Esol solubility (mg/ml) | 1.90E-03 |
| Esol solubility (mol/l) | 4.66E-06 |
| Esol class | Moderately |
| Ali log s | -5.68 |
| Ali solubility (mg/ml) | 8.63E-04 |
| Ali solubility (mol/l) | 2.11E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -8.34 |
| Silicos-it solubility (mg/ml) | 1.88E-06 |
| Silicos-it solubility (mol/l) | 4.60E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.31 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 2.92 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.146 |
| Logd | 4.427 |
| Logp | 5.214 |
| F (20%) | 0.853 |
| F (30%) | 0.136 |
| Mdck | 2.17E-05 |
| Ppb | 0.9911 |
| Vdss | 0.545 |
| Fu | 0.0108 |
| Cyp1a2-inh | 0.537 |
| Cyp1a2-sub | 0.524 |
| Cyp2c19-inh | 0.955 |
| Cyp2c19-sub | 0.086 |
| Cl | 12.392 |
| T12 | 0.078 |
| H-ht | 0.428 |
| Dili | 0.987 |
| Roa | 0.147 |
| Fdamdd | 0.176 |
| Skinsen | 0.043 |
| Ec | 0.004 |
| Ei | 0.503 |
| Respiratory | 0.585 |
| Bcf | 2.141 |
| Igc50 | 4.911 |
| Lc50 | 5.584 |
| Lc50dm | 6.385 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.022 |
| Nr-ahr | 0.437 |
| Nr-aromatase | 0.976 |
| Nr-er | 0.671 |
| Nr-er-lbd | 0.067 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.805 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.509 |
| Sr-mmp | 0.881 |
| Sr-p53 | 0.057 |
| Vol | 432.346 |
| Dense | 0.944 |
| Flex | 20 |
| Nstereo | 0.45 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.504 |
| Fsp3 | 1.965 |
| Mce-18 | 0.25 |
| Natural product-likeness | 18 |
| Alarm nmr | -1.385 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |