| General Information | |
|---|---|
| ZINC ID | ZINC000095583228 |
| Molecular Weight (Da) | 459 |
| SMILES | CCN(CC)c1ccc(CN(c2ccc(Cl)cc2)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| Molecular Formula | C24Cl1N2O3S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.592 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| LogP | 5.615 |
| Activity (Ki) in nM | 14.125 |
| Polar Surface Area (PSA) | 58.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.9060083 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.8 |
| Xlogp3 | 5.58 |
| Wlogp | 6.52 |
| Mlogp | 4.15 |
| Silicos-it log p | 4.07 |
| Consensus log p | 4.82 |
| Esol log s | -6.04 |
| Esol solubility (mg/ml) | 4.22E-04 |
| Esol solubility (mol/l) | 9.19E-07 |
| Esol class | Poorly sol |
| Ali log s | -6.56 |
| Ali solubility (mg/ml) | 1.25E-04 |
| Ali solubility (mol/l) | 2.73E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.63 |
| Silicos-it solubility (mg/ml) | 1.08E-06 |
| Silicos-it solubility (mol/l) | 2.36E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.14 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.22 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.671 |
| Logd | 4.388 |
| Logp | 5.991 |
| F (20%) | 0.004 |
| F (30%) | 0.01 |
| Mdck | 9.49E-06 |
| Ppb | 0.9977 |
| Vdss | 0.67 |
| Fu | 0.0066 |
| Cyp1a2-inh | 0.445 |
| Cyp1a2-sub | 0.893 |
| Cyp2c19-inh | 0.913 |
| Cyp2c19-sub | 0.297 |
| Cl | 6.162 |
| T12 | 0.053 |
| H-ht | 0.214 |
| Dili | 0.988 |
| Roa | 0.383 |
| Fdamdd | 0.175 |
| Skinsen | 0.068 |
| Ec | 0.003 |
| Ei | 0.04 |
| Respiratory | 0.589 |
| Bcf | 2.003 |
| Igc50 | 4.97 |
| Lc50 | 5.986 |
| Lc50dm | 6.912 |
| Nr-ar | 0.048 |
| Nr-ar-lbd | 0.027 |
| Nr-ahr | 0.289 |
| Nr-aromatase | 0.972 |
| Nr-er | 0.761 |
| Nr-er-lbd | 0.202 |
| Nr-ppar-gamma | 0.027 |
| Sr-are | 0.877 |
| Sr-atad5 | 0.017 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.911 |
| Sr-p53 | 0.402 |
| Vol | 456.347 |
| Dense | 1.004 |
| Flex | 20 |
| Nstereo | 0.45 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.419 |
| Fsp3 | 2.096 |
| Mce-18 | 0.25 |
| Natural product-likeness | 20 |
| Alarm nmr | -1.558 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |