| General Information | |
|---|---|
| ZINC ID | ZINC000095577441 |
| Molecular Weight (Da) | 409 |
| SMILES | CCCCCCCC(C)(C)c1cc(O)c2cc(Cc3ccccc3O)c(=O)oc2c1 |
| Molecular Formula | C26O4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.118 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| LogP | 7.589 |
| Activity (Ki) in nM | 1174.9 |
| Polar Surface Area (PSA) | 70.67 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.11874151 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.42 |
| Ilogp | 4.09 |
| Xlogp3 | 8.05 |
| Wlogp | 6.43 |
| Mlogp | 4.36 |
| Silicos-it log p | 7.1 |
| Consensus log p | 6.01 |
| Esol log s | -7.25 |
| Esol solubility (mg/ml) | 0.0000232 |
| Esol solubility (mol/l) | 5.69E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.39 |
| Ali solubility (mg/ml) | 0.00000016 |
| Ali solubility (mol/l) | 4.09E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.94 |
| Silicos-it solubility (mg/ml) | 0.00000047 |
| Silicos-it solubility (mol/l) | 1.16E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.08 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.24 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.128 |
| Logd | 4.899 |
| Logp | 7.279 |
| F (20%) | 0.979 |
| F (30%) | 0.995 |
| Mdck | - |
| Ppb | 100.39% |
| Vdss | 0.686 |
| Fu | 0.88% |
| Cyp1a2-inh | 0.325 |
| Cyp1a2-sub | 0.616 |
| Cyp2c19-inh | 0.913 |
| Cyp2c19-sub | 0.088 |
| Cl | 3.977 |
| T12 | 0.178 |
| H-ht | 0.192 |
| Dili | 0.871 |
| Roa | 0.407 |
| Fdamdd | 0.863 |
| Skinsen | 0.942 |
| Ec | 0.004 |
| Ei | 0.939 |
| Respiratory | 0.148 |
| Bcf | 1.664 |
| Igc50 | 5.67 |
| Lc50 | 5.957 |
| Lc50dm | 6.143 |
| Nr-ar | 0.07 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.248 |
| Nr-aromatase | 0.829 |
| Nr-er | 0.836 |
| Nr-er-lbd | 0.909 |
| Nr-ppar-gamma | 0.98 |
| Sr-are | 0.883 |
| Sr-atad5 | 0.02 |
| Sr-hse | 0.744 |
| Sr-mmp | 0.984 |
| Sr-p53 | 0.859 |
| Vol | 446.652 |
| Dense | 0.914 |
| Flex | 0.5 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.316 |
| Synth | 2.658 |
| Fsp3 | 0.423 |
| Mce-18 | 20 |
| Natural product-likeness | 0.654 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |