| General Information | |
|---|---|
| ZINC ID | ZINC000095571778 |
| Molecular Weight (Da) | 539 |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| Molecular Formula | C27Cl2N6O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 145.51 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| LogP | 6.3 |
| Activity (Ki) in nM | 1698.244 |
| Polar Surface Area (PSA) | 85.17 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.028 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.79 |
| Xlogp3 | 6.34 |
| Wlogp | 5.9 |
| Mlogp | 4.65 |
| Silicos-it log p | 4.29 |
| Consensus log p | 5.19 |
| Esol log s | -7.14 |
| Esol solubility (mg/ml) | 0.0000394 |
| Esol solubility (mol/l) | 0.00000007 |
| Esol class | Poorly sol |
| Ali log s | -7.92 |
| Ali solubility (mg/ml) | 0.0000065 |
| Ali solubility (mol/l) | 1.21E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.83 |
| Silicos-it solubility (mg/ml) | 0.0000008 |
| Silicos-it solubility (mol/l) | 1.49E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.09 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.142 |
| Logd | 4.328 |
| Logp | 5.549 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | 3.35E-05 |
| Ppb | 0.9761 |
| Vdss | 0.964 |
| Fu | 0.039 |
| Cyp1a2-inh | 0.732 |
| Cyp1a2-sub | 0.347 |
| Cyp2c19-inh | 0.847 |
| Cyp2c19-sub | 0.137 |
| Cl | 5.947 |
| T12 | 0.119 |
| H-ht | 0.889 |
| Dili | 0.978 |
| Roa | 0.897 |
| Fdamdd | 0.93 |
| Skinsen | 0.083 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.449 |
| Bcf | 1.637 |
| Igc50 | 4.488 |
| Lc50 | 5.243 |
| Lc50dm | 4.912 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.012 |
| Nr-ahr | 0.901 |
| Nr-aromatase | 0.907 |
| Nr-er | 0.807 |
| Nr-er-lbd | 0.669 |
| Nr-ppar-gamma | 0.895 |
| Sr-are | 0.888 |
| Sr-atad5 | 0.248 |
| Sr-hse | 0.74 |
| Sr-mmp | 0.764 |
| Sr-p53 | 0.926 |
| Vol | 517.748 |
| Dense | 1.039 |
| Flex | 0.241 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 2 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 3 |
| Qed | 0.329 |
| Synth | 2.604 |
| Fsp3 | 0.333 |
| Mce-18 | 68.333 |
| Natural product-likeness | -1.524 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Rejected |