| General Information | |
|---|---|
| ZINC ID | ZINC000095563353 |
| Molecular Weight (Da) | 407 |
| SMILES | O=C(Nc1sc2c(c1C(=O)N1CCOCC1)CCOC2)c1ccccc1Cl |
| Molecular Formula | C19Cl1N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.471 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| LogP | 2.314 |
| Activity (Ki) in nM | 229.087 |
| Polar Surface Area (PSA) | 96.11 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.926 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.37 |
| Ilogp | 2.91 |
| Xlogp3 | 2.76 |
| Wlogp | 2.48 |
| Mlogp | 1.86 |
| Silicos-it log p | 4.46 |
| Consensus log p | 2.89 |
| Esol log s | -4.07 |
| Esol solubility (mg/ml) | 0.0344 |
| Esol solubility (mol/l) | 0.0000845 |
| Esol class | Moderately |
| Ali log s | -4.43 |
| Ali solubility (mg/ml) | 0.015 |
| Ali solubility (mol/l) | 0.0000369 |
| Ali class | Moderately |
| Silicos-it logsw | -5.42 |
| Silicos-it solubility (mg/ml) | 0.00154 |
| Silicos-it solubility (mol/l) | 0.00000379 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.82 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.5 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.027 |
| Logd | 2.901 |
| Logp | 2.392 |
| F (20%) | 0.098 |
| F (30%) | 0.172 |
| Mdck | 3.58E-05 |
| Ppb | 0.9594 |
| Vdss | 1.001 |
| Fu | 0.0371 |
| Cyp1a2-inh | 0.742 |
| Cyp1a2-sub | 0.171 |
| Cyp2c19-inh | 0.798 |
| Cyp2c19-sub | 0.517 |
| Cl | 3.382 |
| T12 | 0.113 |
| H-ht | 0.952 |
| Dili | 0.949 |
| Roa | 0.852 |
| Fdamdd | 0.018 |
| Skinsen | 0.23 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.038 |
| Bcf | 0.786 |
| Igc50 | 2.936 |
| Lc50 | 3.367 |
| Lc50dm | 4.36 |
| Nr-ar | 0.022 |
| Nr-ar-lbd | 0.581 |
| Nr-ahr | 0.929 |
| Nr-aromatase | 0.308 |
| Nr-er | 0.593 |
| Nr-er-lbd | 0.636 |
| Nr-ppar-gamma | 0.965 |
| Sr-are | 0.405 |
| Sr-atad5 | 0.265 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.369 |
| Sr-p53 | 0.466 |
| Vol | 375.374 |
| Dense | 1.082 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.849 |
| Synth | 2.389 |
| Fsp3 | 0.368 |
| Mce-18 | 53.308 |
| Natural product-likeness | -2.13 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |