| General Information | |
|---|---|
| ZINC ID | ZINC000095561717 |
| Molecular Weight (Da) | 438 |
| SMILES | O=C(Nc1sc2c(c1C(=O)N1CCCCC1)CCOC2)c1ccccc1C(F)(F)F |
| Molecular Formula | C21F3N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 107.707 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 3.821 |
| Activity (Ki) in nM | 602.56 |
| Polar Surface Area (PSA) | 86.88 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.96454316 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.43 |
| Ilogp | 2.65 |
| Xlogp3 | 4.23 |
| Wlogp | 5.15 |
| Mlogp | 3.22 |
| Silicos-it log p | 5.52 |
| Consensus log p | 4.15 |
| Esol log s | -5.1 |
| Esol solubility (mg/ml) | 0.00349 |
| Esol solubility (mol/l) | 0.00000797 |
| Esol class | Moderately |
| Ali log s | -5.77 |
| Ali solubility (mg/ml) | 0.000753 |
| Ali solubility (mol/l) | 0.00000172 |
| Ali class | Moderately |
| Silicos-it logsw | -6.2 |
| Silicos-it solubility (mg/ml) | 0.000276 |
| Silicos-it solubility (mol/l) | 0.00000063 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.97 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.704 |
| Logd | 3.551 |
| Logp | 4.043 |
| F (20%) | 0.016 |
| F (30%) | 0.016 |
| Mdck | - |
| Ppb | 97.53% |
| Vdss | 1.336 |
| Fu | 1.40% |
| Cyp1a2-inh | 0.433 |
| Cyp1a2-sub | 0.817 |
| Cyp2c19-inh | 0.901 |
| Cyp2c19-sub | 0.288 |
| Cl | 3.125 |
| T12 | 0.021 |
| H-ht | 0.977 |
| Dili | 0.918 |
| Roa | 0.912 |
| Fdamdd | 0.5 |
| Skinsen | 0.171 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.28 |
| Bcf | 1.067 |
| Igc50 | 3.625 |
| Lc50 | 4.938 |
| Lc50dm | 4.699 |
| Nr-ar | 0.141 |
| Nr-ar-lbd | 0.482 |
| Nr-ahr | 0.918 |
| Nr-aromatase | 0.69 |
| Nr-er | 0.597 |
| Nr-er-lbd | 0.57 |
| Nr-ppar-gamma | 0.975 |
| Sr-are | 0.544 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.018 |
| Sr-mmp | 0.754 |
| Sr-p53 | 0.509 |
| Vol | 404.167 |
| Dense | 1.084 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.755 |
| Synth | 2.499 |
| Fsp3 | 0.429 |
| Mce-18 | 60.8 |
| Natural product-likeness | -1.813 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |