| General Information | |
|---|---|
| ZINC ID | ZINC000095559553 |
| Molecular Weight (Da) | 458 |
| SMILES | COC1CN(C(=O)c2c(NC(=O)c3c(F)cccc3C(F)(F)F)sc3c2CCOC3)C1 |
| Molecular Formula | C20F4N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 104.527 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 2.826 |
| Activity (Ki) in nM | 23.988 |
| Polar Surface Area (PSA) | 96.11 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.88748407 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.4 |
| Ilogp | 3.14 |
| Xlogp3 | 3.18 |
| Wlogp | 4.55 |
| Mlogp | 2.3 |
| Silicos-it log p | 5.13 |
| Consensus log p | 3.66 |
| Esol log s | -4.49 |
| Esol solubility (mg/ml) | 0.015 |
| Esol solubility (mol/l) | 0.0000326 |
| Esol class | Moderately |
| Ali log s | -4.87 |
| Ali solubility (mg/ml) | 0.00619 |
| Ali solubility (mol/l) | 0.0000135 |
| Ali class | Moderately |
| Silicos-it logsw | -5.8 |
| Silicos-it solubility (mg/ml) | 0.000728 |
| Silicos-it solubility (mol/l) | 0.00000159 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.84 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.66 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.148 |
| Logd | 2.891 |
| Logp | 2.424 |
| F (20%) | 0.03 |
| F (30%) | 0.002 |
| Mdck | 2.13E-05 |
| Ppb | 0.9674 |
| Vdss | 1.119 |
| Fu | 0.0245 |
| Cyp1a2-inh | 0.346 |
| Cyp1a2-sub | 0.637 |
| Cyp2c19-inh | 0.903 |
| Cyp2c19-sub | 0.732 |
| Cl | 3.04 |
| T12 | 0.022 |
| H-ht | 0.99 |
| Dili | 0.958 |
| Roa | 0.963 |
| Fdamdd | 0.855 |
| Skinsen | 0.118 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.639 |
| Bcf | 1.149 |
| Igc50 | 3.348 |
| Lc50 | 3.505 |
| Lc50dm | 6.419 |
| Nr-ar | 0.208 |
| Nr-ar-lbd | 0.696 |
| Nr-ahr | 0.911 |
| Nr-aromatase | 0.877 |
| Nr-er | 0.359 |
| Nr-er-lbd | 0.601 |
| Nr-ppar-gamma | 0.966 |
| Sr-are | 0.485 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.021 |
| Sr-mmp | 0.623 |
| Sr-p53 | 0.553 |
| Vol | 401.729 |
| Dense | 1.14 |
| Flex | 0.318 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 1 |
| Qed | 0.71 |
| Synth | 2.835 |
| Fsp3 | 0.4 |
| Mce-18 | 63.143 |
| Natural product-likeness | -1.784 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Accepted |