| General Information | |
|---|---|
| ZINC ID | ZINC000095558569 |
| Molecular Weight (Da) | 490 |
| SMILES | O=C(Nc1sc2c(c1C(=O)N1CCC(F)(F)CC1)CCOC2)c1ccccc1OC(F)(F)F |
| Molecular Formula | C21F5N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 108.769 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 4.903 |
| Activity (Ki) in nM | 125.893 |
| Polar Surface Area (PSA) | 96.11 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.99214112 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.43 |
| Ilogp | 3.13 |
| Xlogp3 | 4.84 |
| Wlogp | 6.22 |
| Mlogp | 2.62 |
| Silicos-it log p | 5.48 |
| Consensus log p | 4.46 |
| Esol log s | -5.71 |
| Esol solubility (mg/ml) | 0.000946 |
| Esol solubility (mol/l) | 0.00000193 |
| Esol class | Moderately |
| Ali log s | -6.59 |
| Ali solubility (mg/ml) | 0.000125 |
| Ali solubility (mol/l) | 0.00000025 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.43 |
| Silicos-it solubility (mg/ml) | 0.000181 |
| Silicos-it solubility (mol/l) | 0.00000036 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.86 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.124 |
| Logd | 3.714 |
| Logp | 4.547 |
| F (20%) | 0.014 |
| F (30%) | 0.009 |
| Mdck | - |
| Ppb | 98.17% |
| Vdss | 1.734 |
| Fu | 0.78% |
| Cyp1a2-inh | 0.241 |
| Cyp1a2-sub | 0.93 |
| Cyp2c19-inh | 0.848 |
| Cyp2c19-sub | 0.32 |
| Cl | 3.898 |
| T12 | 0.024 |
| H-ht | 0.994 |
| Dili | 0.965 |
| Roa | 0.962 |
| Fdamdd | 0.845 |
| Skinsen | 0.117 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.547 |
| Bcf | 1.162 |
| Igc50 | 3.32 |
| Lc50 | 5.245 |
| Lc50dm | 5.371 |
| Nr-ar | 0.114 |
| Nr-ar-lbd | 0.736 |
| Nr-ahr | 0.927 |
| Nr-aromatase | 0.86 |
| Nr-er | 0.29 |
| Nr-er-lbd | 0.64 |
| Nr-ppar-gamma | 0.961 |
| Sr-are | 0.49 |
| Sr-atad5 | 0.078 |
| Sr-hse | 0.019 |
| Sr-mmp | 0.477 |
| Sr-p53 | 0.66 |
| Vol | 425.092 |
| Dense | 1.153 |
| Flex | 0.292 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.623 |
| Synth | 2.845 |
| Fsp3 | 0.429 |
| Mce-18 | 68.4 |
| Natural product-likeness | -1.592 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |