| General Information | |
|---|---|
| ZINC ID | ZINC000095556475 |
| Molecular Weight (Da) | 368 |
| SMILES | CCC[C@H]1COc2ccc(C)c3c(=O)c(C(=O)NC4CCCCC4)cn1c23 |
| Molecular Formula | C22N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.874 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| LogP | 4.829 |
| Activity (Ki) in nM | 38.019 |
| Polar Surface Area (PSA) | 60.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.72407639 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.55 |
| Ilogp | 3.31 |
| Xlogp3 | 4.42 |
| Wlogp | 4.11 |
| Mlogp | 2.44 |
| Silicos-it log p | 4.16 |
| Consensus log p | 3.69 |
| Esol log s | -4.85 |
| Esol solubility (mg/ml) | 0.00517 |
| Esol solubility (mol/l) | 0.000014 |
| Esol class | Moderately |
| Ali log s | -5.4 |
| Ali solubility (mg/ml) | 0.00145 |
| Ali solubility (mol/l) | 0.00000394 |
| Ali class | Moderately |
| Silicos-it logsw | -5.81 |
| Silicos-it solubility (mg/ml) | 0.000568 |
| Silicos-it solubility (mol/l) | 0.00000154 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.41 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.8 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.085 |
| Logd | 3.382 |
| Logp | 4.724 |
| F (20%) | 0.035 |
| F (30%) | 0.009 |
| Mdck | 2.26E-05 |
| Ppb | 0.9678 |
| Vdss | 1.797 |
| Fu | 0.027 |
| Cyp1a2-inh | 0.418 |
| Cyp1a2-sub | 0.763 |
| Cyp2c19-inh | 0.711 |
| Cyp2c19-sub | 0.353 |
| Cl | 2.609 |
| T12 | 0.066 |
| H-ht | 0.855 |
| Dili | 0.619 |
| Roa | 0.244 |
| Fdamdd | 0.911 |
| Skinsen | 0.782 |
| Ec | 0.003 |
| Ei | 0.023 |
| Respiratory | 0.37 |
| Bcf | 1.269 |
| Igc50 | 4.763 |
| Lc50 | 4.472 |
| Lc50dm | 5.402 |
| Nr-ar | 0.239 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.888 |
| Nr-aromatase | 0.872 |
| Nr-er | 0.293 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.795 |
| Sr-are | 0.687 |
| Sr-atad5 | 0.066 |
| Sr-hse | 0.229 |
| Sr-mmp | 0.491 |
| Sr-p53 | 0.867 |
| Vol | 387.388 |
| Dense | 0.95 |
| Flex | 0.217 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.884 |
| Synth | 3.104 |
| Fsp3 | 0.545 |
| Mce-18 | 76.353 |
| Natural product-likeness | -0.409 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |