| General Information | |
|---|---|
| ZINC ID | ZINC000095556337 |
| Molecular Weight (Da) | 318 |
| SMILES | CCCCCn1cc(C(=O)NCC2CC2)c(=O)cc1C(C)(C)C |
| Molecular Formula | C19N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 91.413 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| LogP | 4.422 |
| Activity (Ki) in nM | 177.828 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.43264058 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 3.98 |
| Xlogp3 | 4.54 |
| Wlogp | 3.41 |
| Mlogp | 2.27 |
| Silicos-it log p | 4.25 |
| Consensus log p | 3.69 |
| Esol log s | -4.27 |
| Esol solubility (mg/ml) | 0.017 |
| Esol solubility (mol/l) | 0.0000533 |
| Esol class | Moderately |
| Ali log s | -5.34 |
| Ali solubility (mg/ml) | 0.00147 |
| Ali solubility (mol/l) | 0.00000462 |
| Ali class | Moderately |
| Silicos-it logsw | -5.31 |
| Silicos-it solubility (mg/ml) | 0.00157 |
| Silicos-it solubility (mol/l) | 0.00000492 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.02 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.84 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.828 |
| Logd | 3.041 |
| Logp | 3.96 |
| F (20%) | 0.963 |
| F (30%) | 0.526 |
| Mdck | - |
| Ppb | 91.76% |
| Vdss | 1.13 |
| Fu | 7.54% |
| Cyp1a2-inh | 0.294 |
| Cyp1a2-sub | 0.927 |
| Cyp2c19-inh | 0.806 |
| Cyp2c19-sub | 0.695 |
| Cl | 2.586 |
| T12 | 0.146 |
| H-ht | 0.374 |
| Dili | 0.303 |
| Roa | 0.157 |
| Fdamdd | 0.847 |
| Skinsen | 0.205 |
| Ec | 0.003 |
| Ei | 0.031 |
| Respiratory | 0.082 |
| Bcf | 1.358 |
| Igc50 | 4.407 |
| Lc50 | 5.279 |
| Lc50dm | 4.729 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.058 |
| Nr-aromatase | 0.629 |
| Nr-er | 0.1 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.213 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.518 |
| Sr-mmp | 0.349 |
| Sr-p53 | 0.026 |
| Vol | 349.095 |
| Dense | 0.912 |
| Flex | 0.818 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.783 |
| Synth | 2.545 |
| Fsp3 | 0.684 |
| Mce-18 | 32.812 |
| Natural product-likeness | -0.696 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |