| General Information | |
|---|---|
| ZINC ID | ZINC000095556061 |
| Molecular Weight (Da) | 402 |
| SMILES | Cc1cc2c3c(c1)c(=O)c(C(=O)NC1CCCCC1)cn3[C@@H](c1ccccc1)CO2 |
| Molecular Formula | C25N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.613 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| LogP | 5.084 |
| Activity (Ki) in nM | 1348.96 |
| Polar Surface Area (PSA) | 60.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.10326623 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.36 |
| Ilogp | 4.14 |
| Xlogp3 | 4.63 |
| Wlogp | 4.35 |
| Mlogp | 2.85 |
| Silicos-it log p | 4.43 |
| Consensus log p | 4.08 |
| Esol log s | -5.38 |
| Esol solubility (mg/ml) | 0.00167 |
| Esol solubility (mol/l) | 0.00000414 |
| Esol class | Moderately |
| Ali log s | -5.62 |
| Ali solubility (mg/ml) | 0.00096 |
| Ali solubility (mol/l) | 0.00000238 |
| Ali class | Moderately |
| Silicos-it logsw | -7.1 |
| Silicos-it solubility (mg/ml) | 0.0000317 |
| Silicos-it solubility (mol/l) | 7.87E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.47 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.642 |
| Logd | 3.525 |
| Logp | 4.897 |
| F (20%) | 0.183 |
| F (30%) | 0.985 |
| Mdck | - |
| Ppb | 97.05% |
| Vdss | 1.989 |
| Fu | 2.00% |
| Cyp1a2-inh | 0.242 |
| Cyp1a2-sub | 0.544 |
| Cyp2c19-inh | 0.84 |
| Cyp2c19-sub | 0.205 |
| Cl | 2.453 |
| T12 | 0.043 |
| H-ht | 0.764 |
| Dili | 0.916 |
| Roa | 0.441 |
| Fdamdd | 0.964 |
| Skinsen | 0.28 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.577 |
| Bcf | 1.174 |
| Igc50 | 4.971 |
| Lc50 | 5.839 |
| Lc50dm | 5.464 |
| Nr-ar | 0.075 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.874 |
| Nr-aromatase | 0.775 |
| Nr-er | 0.497 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.771 |
| Sr-are | 0.548 |
| Sr-atad5 | 0.432 |
| Sr-hse | 0.539 |
| Sr-mmp | 0.606 |
| Sr-p53 | 0.829 |
| Vol | 422.81 |
| Dense | 0.951 |
| Flex | 0.138 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.708 |
| Synth | 2.938 |
| Fsp3 | 0.36 |
| Mce-18 | 90.235 |
| Natural product-likeness | -0.543 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |