| General Information | |
|---|---|
| ZINC ID | ZINC000095552584 |
| Molecular Weight (Da) | 428 |
| SMILES | CC[C@H]1COc2c(F)c(F)cc3c(=O)c(C(=O)NC45CC6CC(CC(C6)C4)C5)cn1c23 |
| Molecular Formula | C24F2N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 108.267 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| LogP | 4.582 |
| Activity (Ki) in nM | 1737.8 |
| Polar Surface Area (PSA) | 60.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.70714467 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.58 |
| Ilogp | 3.43 |
| Xlogp3 | 4.46 |
| Wlogp | 5.16 |
| Mlogp | 3.61 |
| Silicos-it log p | 4.62 |
| Consensus log p | 4.26 |
| Esol log s | -5.28 |
| Esol solubility (mg/ml) | 0.00224 |
| Esol solubility (mol/l) | 0.00000524 |
| Esol class | Moderately |
| Ali log s | -5.45 |
| Ali solubility (mg/ml) | 0.00153 |
| Ali solubility (mol/l) | 0.00000358 |
| Ali class | Moderately |
| Silicos-it logsw | -6.16 |
| Silicos-it solubility (mg/ml) | 0.000298 |
| Silicos-it solubility (mol/l) | 0.00000069 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.75 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.78 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.6 |
| Logd | 3.662 |
| Logp | 4.874 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 90.23% |
| Vdss | 0.952 |
| Fu | 2.54% |
| Cyp1a2-inh | 0.163 |
| Cyp1a2-sub | 0.186 |
| Cyp2c19-inh | 0.862 |
| Cyp2c19-sub | 0.105 |
| Cl | 1.76 |
| T12 | 0.011 |
| H-ht | 0.94 |
| Dili | 0.187 |
| Roa | 0.045 |
| Fdamdd | 0.861 |
| Skinsen | 0.136 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.715 |
| Bcf | 2.947 |
| Igc50 | 4.463 |
| Lc50 | 5.43 |
| Lc50dm | 6.7 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.723 |
| Nr-aromatase | 0.018 |
| Nr-er | 0.298 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.084 |
| Sr-are | 0.762 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.622 |
| Sr-mmp | 0.452 |
| Sr-p53 | 0.854 |
| Vol | 417.002 |
| Dense | 1.027 |
| Flex | 0.138 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.792 |
| Synth | 4.558 |
| Fsp3 | 0.583 |
| Mce-18 | 123.474 |
| Natural product-likeness | -0.602 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |