| General Information | |
|---|---|
| ZINC ID | ZINC000095552403 |
| Molecular Weight (Da) | 441 |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cn2c3c(cccc3c1=O)OC[C@H]2c1ccccc1 |
| Molecular Formula | C28N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.174 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| LogP | 4.882 |
| Activity (Ki) in nM | 14.125 |
| Polar Surface Area (PSA) | 60.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.02025783 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.43 |
| Ilogp | 3.57 |
| Xlogp3 | 5.13 |
| Wlogp | 4.68 |
| Mlogp | 3.45 |
| Silicos-it log p | 4.42 |
| Consensus log p | 4.25 |
| Esol log s | -5.9 |
| Esol solubility (mg/ml) | 0.000557 |
| Esol solubility (mol/l) | 0.00000126 |
| Esol class | Moderately |
| Ali log s | -6.14 |
| Ali solubility (mg/ml) | 0.000318 |
| Ali solubility (mol/l) | 0.00000072 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.31 |
| Silicos-it solubility (mg/ml) | 0.0000215 |
| Silicos-it solubility (mol/l) | 4.89E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.34 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.8 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.165 |
| Logd | 4.239 |
| Logp | 5.194 |
| F (20%) | 0.002 |
| F (30%) | 0.437 |
| Mdck | 2.91E-05 |
| Ppb | 0.956 |
| Vdss | 0.702 |
| Fu | 0.0198 |
| Cyp1a2-inh | 0.159 |
| Cyp1a2-sub | 0.128 |
| Cyp2c19-inh | 0.785 |
| Cyp2c19-sub | 0.103 |
| Cl | 2.177 |
| T12 | 0.012 |
| H-ht | 0.744 |
| Dili | 0.486 |
| Roa | 0.039 |
| Fdamdd | 0.918 |
| Skinsen | 0.136 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.696 |
| Bcf | 2.828 |
| Igc50 | 5.011 |
| Lc50 | 6.221 |
| Lc50dm | 6.353 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.827 |
| Nr-aromatase | 0.016 |
| Nr-er | 0.319 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.046 |
| Sr-are | 0.748 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.835 |
| Sr-mmp | 0.658 |
| Sr-p53 | 0.673 |
| Vol | 457.585 |
| Dense | 0.962 |
| Flex | 0.114 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.643 |
| Synth | 4.264 |
| Fsp3 | 0.429 |
| Mce-18 | 129.6 |
| Natural product-likeness | -0.485 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |