| General Information | |
|---|---|
| ZINC ID | ZINC000084731158 |
| Molecular Weight (Da) | 413 |
| SMILES | CCn1cc(CC(=O)NC23CC4CC(CC(C4)C2)C3)c2cc(-c3ccccc3)ccc21 |
| Molecular Formula | C28N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.449 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 5.355 |
| Activity (Ki) in nM | 691.831 |
| Polar Surface Area (PSA) | 34.03 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.9405089 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.46 |
| Ilogp | 3.93 |
| Xlogp3 | 5.81 |
| Wlogp | 5.96 |
| Mlogp | 4.71 |
| Silicos-it log p | 5.62 |
| Consensus log p | 5.2 |
| Esol log s | -6.02 |
| Esol solubility (mg/ml) | 0.000394 |
| Esol solubility (mol/l) | 0.00000095 |
| Esol class | Poorly sol |
| Ali log s | -6.29 |
| Ali solubility (mg/ml) | 0.000209 |
| Ali solubility (mol/l) | 0.0000005 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.15 |
| Silicos-it solubility (mg/ml) | 0.00000293 |
| Silicos-it solubility (mol/l) | 7.10E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.69 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.28 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.847 |
| Logd | 5.12 |
| Logp | 6.306 |
| F (20%) | 0.079 |
| F (30%) | 0.009 |
| Mdck | - |
| Ppb | 96.06% |
| Vdss | 0.965 |
| Fu | 1.54% |
| Cyp1a2-inh | 0.265 |
| Cyp1a2-sub | 0.15 |
| Cyp2c19-inh | 0.615 |
| Cyp2c19-sub | 0.071 |
| Cl | 5.175 |
| T12 | 0.046 |
| H-ht | 0.506 |
| Dili | 0.163 |
| Roa | 0.184 |
| Fdamdd | 0.742 |
| Skinsen | 0.136 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.656 |
| Bcf | 3.099 |
| Igc50 | 4.974 |
| Lc50 | 6.102 |
| Lc50dm | 6.434 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.881 |
| Nr-aromatase | 0.008 |
| Nr-er | 0.409 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.049 |
| Sr-are | 0.598 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.919 |
| Sr-mmp | 0.63 |
| Sr-p53 | 0.63 |
| Vol | 451.197 |
| Dense | 0.914 |
| Flex | 0.207 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.551 |
| Synth | 3.557 |
| Fsp3 | 0.464 |
| Mce-18 | 77.122 |
| Natural product-likeness | -1.001 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |