| General Information | |
|---|---|
| ZINC ID | ZINC000084672376 |
| Molecular Weight (Da) | 396 |
| SMILES | Cc1c(C(=O)NCCc2ccc(N3CCCCC3)cc2)[nH]c2ccc(Cl)cc12 |
| Molecular Formula | C23Cl1N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.325 |
| HBA | 1 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 5.379 |
| Activity (Ki) in nM | 229.087 |
| Polar Surface Area (PSA) | 48.13 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.02252411 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.35 |
| Ilogp | 3.35 |
| Xlogp3 | 5.58 |
| Wlogp | 4.71 |
| Mlogp | 3.85 |
| Silicos-it log p | 5.64 |
| Consensus log p | 4.63 |
| Esol log s | -5.81 |
| Esol solubility (mg/ml) | 0.000612 |
| Esol solubility (mol/l) | 0.00000155 |
| Esol class | Moderately |
| Ali log s | -6.35 |
| Ali solubility (mg/ml) | 0.000176 |
| Ali solubility (mol/l) | 0.00000044 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.26 |
| Silicos-it solubility (mg/ml) | 0.00000216 |
| Silicos-it solubility (mol/l) | 5.46E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.75 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.67 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.812 |
| Logd | 4.507 |
| Logp | 6.065 |
| F (20%) | 0.013 |
| F (30%) | 0.164 |
| Mdck | - |
| Ppb | 98.68% |
| Vdss | 2.021 |
| Fu | 0.89% |
| Cyp1a2-inh | 0.879 |
| Cyp1a2-sub | 0.658 |
| Cyp2c19-inh | 0.91 |
| Cyp2c19-sub | 0.08 |
| Cl | 5.026 |
| T12 | 0.102 |
| H-ht | 0.727 |
| Dili | 0.67 |
| Roa | 0.774 |
| Fdamdd | 0.887 |
| Skinsen | 0.941 |
| Ec | 0.003 |
| Ei | 0.043 |
| Respiratory | 0.932 |
| Bcf | 1.615 |
| Igc50 | 4.867 |
| Lc50 | 5.468 |
| Lc50dm | 5.972 |
| Nr-ar | 0.023 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.94 |
| Nr-aromatase | 0.943 |
| Nr-er | 0.409 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.042 |
| Sr-are | 0.871 |
| Sr-atad5 | 0.815 |
| Sr-hse | 0.682 |
| Sr-mmp | 0.785 |
| Sr-p53 | 0.722 |
| Vol | 408.038 |
| Dense | 0.968 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.631 |
| Synth | 2.133 |
| Fsp3 | 0.348 |
| Mce-18 | 48.774 |
| Natural product-likeness | -1.343 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |