| General Information | |
|---|---|
| ZINC ID | ZINC000084671682 |
| Molecular Weight (Da) | 361 |
| SMILES | CCc1c(C(=O)NCCc2ccc(Cl)cc2)[nH]c2ccc(Cl)cc12 |
| Molecular Formula | C19Cl2N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 98.161 |
| HBA | 1 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| LogP | 5.42 |
| Activity (Ki) in nM | 758.578 |
| Polar Surface Area (PSA) | 44.89 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.96951043 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.21 |
| Ilogp | 3.16 |
| Xlogp3 | 5.67 |
| Wlogp | 5.01 |
| Mlogp | 4.05 |
| Silicos-it log p | 6.07 |
| Consensus log p | 4.79 |
| Esol log s | -5.72 |
| Esol solubility (mg/ml) | 0.000691 |
| Esol solubility (mol/l) | 0.00000191 |
| Esol class | Moderately |
| Ali log s | -6.38 |
| Ali solubility (mg/ml) | 0.000151 |
| Ali solubility (mol/l) | 0.00000041 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.59 |
| Silicos-it solubility (mg/ml) | 0.00000093 |
| Silicos-it solubility (mol/l) | 2.59E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.48 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.778 |
| Logd | 4.489 |
| Logp | 5.693 |
| F (20%) | 0.005 |
| F (30%) | 0.646 |
| Mdck | - |
| Ppb | 99.27% |
| Vdss | 1.46 |
| Fu | 1.13% |
| Cyp1a2-inh | 0.981 |
| Cyp1a2-sub | 0.707 |
| Cyp2c19-inh | 0.969 |
| Cyp2c19-sub | 0.076 |
| Cl | 5.118 |
| T12 | 0.099 |
| H-ht | 0.307 |
| Dili | 0.226 |
| Roa | 0.237 |
| Fdamdd | 0.939 |
| Skinsen | 0.377 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.479 |
| Bcf | 1.57 |
| Igc50 | 4.576 |
| Lc50 | 5.377 |
| Lc50dm | 6.008 |
| Nr-ar | 0.007 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.935 |
| Nr-aromatase | 0.931 |
| Nr-er | 0.159 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.05 |
| Sr-are | 0.431 |
| Sr-atad5 | 0.096 |
| Sr-hse | 0.591 |
| Sr-mmp | 0.719 |
| Sr-p53 | 0.553 |
| Vol | 351.625 |
| Dense | 1.024 |
| Flex | 0.353 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.659 |
| Synth | 2.076 |
| Fsp3 | 0.211 |
| Mce-18 | 17 |
| Natural product-likeness | -0.934 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |