| General Information | |
|---|---|
| ZINC ID | ZINC000084670310 |
| Molecular Weight (Da) | 442 |
| SMILES | CONC(=O)CCCN(C)C(=O)c1ccc2c(c1)c1c(n2C)CC[C@@H](C2CCOCC2)C1 |
| Molecular Formula | C25N3O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.683 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 2.699 |
| Activity (Ki) in nM | 288.403 |
| Polar Surface Area (PSA) | 72.8 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.49555569 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.6 |
| Ilogp | 3.62 |
| Xlogp3 | 2.65 |
| Wlogp | 3.24 |
| Mlogp | 2.45 |
| Silicos-it log p | 3.39 |
| Consensus log p | 3.07 |
| Esol log s | -3.86 |
| Esol solubility (mg/ml) | 0.0608 |
| Esol solubility (mol/l) | 0.000138 |
| Esol class | Soluble |
| Ali log s | -3.83 |
| Ali solubility (mg/ml) | 0.0653 |
| Ali solubility (mol/l) | 0.000148 |
| Ali class | Soluble |
| Silicos-it logsw | -5.52 |
| Silicos-it solubility (mg/ml) | 0.00133 |
| Silicos-it solubility (mol/l) | 0.00000302 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.11 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.11 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.262 |
| Logd | 1.921 |
| Logp | 2.223 |
| F (20%) | 0.626 |
| F (30%) | 0.986 |
| Mdck | - |
| Ppb | 48.11% |
| Vdss | 1.629 |
| Fu | 19.88% |
| Cyp1a2-inh | 0.1 |
| Cyp1a2-sub | 0.855 |
| Cyp2c19-inh | 0.192 |
| Cyp2c19-sub | 0.593 |
| Cl | 6.038 |
| T12 | 0.394 |
| H-ht | 0.773 |
| Dili | 0.264 |
| Roa | 0.957 |
| Fdamdd | 0.883 |
| Skinsen | 0.163 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.024 |
| Bcf | 0.744 |
| Igc50 | 2.454 |
| Lc50 | 3.199 |
| Lc50dm | 5.374 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.664 |
| Nr-aromatase | 0.062 |
| Nr-er | 0.27 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.014 |
| Sr-are | 0.33 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.097 |
| Sr-p53 | 0.048 |
| Vol | 459.063 |
| Dense | 0.961 |
| Flex | 0.391 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.67 |
| Synth | 3.351 |
| Fsp3 | 0.6 |
| Mce-18 | 79.35 |
| Natural product-likeness | -0.695 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |