| General Information | |
|---|---|
| ZINC ID | ZINC000084654019 |
| Molecular Weight (Da) | 549 |
| SMILES | Cc1c(C(=O)N[C@@H]2CCCN(C(=O)NC(C)C)C2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C26Cl3N5O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 144.859 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| LogP | 6.978 |
| Activity (Ki) in nM | 97.7237 |
| Polar Surface Area (PSA) | 79.26 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.12901306 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.35 |
| Ilogp | 4.97 |
| Xlogp3 | 6.09 |
| Wlogp | 5.74 |
| Mlogp | 4.6 |
| Silicos-it log p | 4.97 |
| Consensus log p | 5.27 |
| Esol log s | -6.9 |
| Esol solubility (mg/ml) | 0.0000689 |
| Esol solubility (mol/l) | 0.00000012 |
| Esol class | Poorly sol |
| Ali log s | -7.54 |
| Ali solubility (mg/ml) | 0.000016 |
| Ali solubility (mol/l) | 2.92E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.76 |
| Silicos-it solubility (mg/ml) | 0.00000095 |
| Silicos-it solubility (mol/l) | 1.73E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.32 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.23 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.029 |
| Logd | 4.764 |
| Logp | 5.914 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.24% |
| Vdss | 1.363 |
| Fu | 2.41% |
| Cyp1a2-inh | 0.164 |
| Cyp1a2-sub | 0.831 |
| Cyp2c19-inh | 0.898 |
| Cyp2c19-sub | 0.576 |
| Cl | 3.16 |
| T12 | 0.036 |
| H-ht | 0.906 |
| Dili | 0.964 |
| Roa | 0.475 |
| Fdamdd | 0.195 |
| Skinsen | 0.066 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.053 |
| Bcf | 2.118 |
| Igc50 | 4.328 |
| Lc50 | 5.618 |
| Lc50dm | 5.662 |
| Nr-ar | 0.096 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.917 |
| Nr-aromatase | 0.935 |
| Nr-er | 0.501 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.498 |
| Sr-are | 0.82 |
| Sr-atad5 | 0.015 |
| Sr-hse | 0.422 |
| Sr-mmp | 0.79 |
| Sr-p53 | 0.917 |
| Vol | 515.859 |
| Dense | 1.061 |
| Flex | 0.32 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.403 |
| Synth | 2.977 |
| Fsp3 | 0.346 |
| Mce-18 | 85.429 |
| Natural product-likeness | -1.678 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |